The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-methyl-1-(2,4,5-trichlorophenyl)-3-(5-(3-(trifluoromethyl)phenylamino)-1,3,4-thiadiazol-2-yl)pyridazin-4(1H)-one ID: ALA2270906
PubChem CID: 10896759
Max Phase: Preclinical
Molecular Formula: C20H11Cl3F3N5OS
Molecular Weight: 532.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)c(-c2nnc(Nc3cccc(C(F)(F)F)c3)s2)nn1-c1cc(Cl)c(Cl)cc1Cl
Standard InChI: InChI=1S/C20H11Cl3F3N5OS/c1-9-5-16(32)17(30-31(9)15-8-13(22)12(21)7-14(15)23)18-28-29-19(33-18)27-11-4-2-3-10(6-11)20(24,25)26/h2-8H,1H3,(H,27,29)
Standard InChI Key: WHLLPEZRJDILRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
22.4787 -16.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6471 -16.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2345 -17.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6481 -18.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4786 -18.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8875 -17.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7167 -17.5173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1316 -18.2372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9599 -18.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3724 -17.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9589 -16.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1319 -16.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1974 -17.5191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3729 -18.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0691 -19.7235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7076 -20.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4010 -19.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1913 -19.0012 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.1799 -20.0971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3095 -20.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6634 -21.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7885 -22.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5519 -22.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1972 -22.0385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0754 -21.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7208 -16.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9648 -22.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0866 -23.1569 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.6105 -21.8274 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.6746 -22.7497 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.8940 -18.9465 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.4095 -17.5144 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.2359 -16.0905 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 2 0
9 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
12 26 1 0
24 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
5 31 1 0
3 32 1 0
2 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.76Molecular Weight (Monoisotopic): 530.9702AlogP: 6.78#Rotatable Bonds: 4Polar Surface Area: 72.70Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.40CX Basic pKa: ┄CX LogP: 7.21CX LogD: 7.21Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -2.06
References 1. Zou XJ, Jin GY, Zhang ZX.. (2002) Synthesis, fungicidal activity, and QSAR of pyridazinonethiadiazoles., 50 (6): [PMID:11879019 ] [10.1021/jf0109266 ] 2. Zou XJ, Lai LH, Jin GY, Zhang ZX.. (2002) Synthesis, fungicidal activity, and 3D-QSAR of pyridazinone-substituted 1,3,4-oxadiazoles and 1,3,4-thiadiazoles., 50 (13): [PMID:12059155 ] [10.1021/jf0201677 ]