The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{5-[2-(1-Pyrrolidinesulfamoyl)-4,5-dimethoxy-benzyl]-1,3,4-thiadiazol-2-yl}-N-(p-chlorophenyl)amine ID: ALA2270946
PubChem CID: 46177209
Max Phase: Preclinical
Molecular Formula: C21H23ClN4O4S2
Molecular Weight: 495.03
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Cc2nnc(Nc3ccc(Cl)cc3)s2)c(S(=O)(=O)N2CCCC2)cc1OC
Standard InChI: InChI=1S/C21H23ClN4O4S2/c1-29-17-11-14(19(13-18(17)30-2)32(27,28)26-9-3-4-10-26)12-20-24-25-21(31-20)23-16-7-5-15(22)6-8-16/h5-8,11,13H,3-4,9-10,12H2,1-2H3,(H,23,25)
Standard InChI Key: SBKPMSFUSGSTEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
10.9186 -12.9809 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.7358 -12.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3261 -12.2725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7937 -11.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7926 -12.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5006 -12.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2103 -12.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2074 -11.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4988 -11.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0845 -12.9819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3771 -12.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0859 -11.3459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0857 -10.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9199 -13.7980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9136 -11.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8924 -10.5185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5409 -10.0224 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.2684 -9.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4514 -9.2730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2191 -10.0564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7269 -8.5766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5440 -8.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9548 -9.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7659 -9.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1714 -8.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7488 -7.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9380 -7.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9885 -8.5397 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.2630 -14.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5168 -15.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3340 -15.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5852 -14.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
4 12 1 0
12 13 1 0
7 1 1 0
1 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
18 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
14 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 14 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.03Molecular Weight (Monoisotopic): 494.0849AlogP: 4.33#Rotatable Bonds: 8Polar Surface Area: 93.65Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.45CX Basic pKa: 0.59CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.89
References 1. Camoutsis C, Geronikaki A, Ciric A, Soković M, Zoumpoulakis P, Zervou M.. (2010) Sulfonamide-1,2,4-thiadiazole derivatives as antifungal and antibacterial agents: synthesis, biological evaluation, lipophilicity, and conformational studies., 58 (2): [PMID:20118573 ] [10.1248/cpb.58.160 ]