The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{5-[2-(1-Piperidinesulfamoyl)-4,5-dimethoxy-benzyl]-1,3,4-thiadiazol-2-yl}-N-(p-nitrolphenyl)amine ID: ALA2270950
PubChem CID: 46177283
Max Phase: Preclinical
Molecular Formula: C22H25N5O6S2
Molecular Weight: 519.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Cc2nnc(Nc3ccc([N+](=O)[O-])cc3)s2)c(S(=O)(=O)N2CCCCC2)cc1OC
Standard InChI: InChI=1S/C22H25N5O6S2/c1-32-18-12-15(20(14-19(18)33-2)35(30,31)26-10-4-3-5-11-26)13-21-24-25-22(34-21)23-16-6-8-17(9-7-16)27(28)29/h6-9,12,14H,3-5,10-11,13H2,1-2H3,(H,23,25)
Standard InChI Key: WNZQKOGPKJIWDI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
10.5100 -21.7058 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3272 -21.7045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9175 -20.9975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3851 -20.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3840 -21.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0920 -21.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8017 -21.2983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7988 -20.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0902 -20.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6759 -21.7068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9685 -21.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6773 -20.0708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6771 -19.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5113 -22.5230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5050 -20.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4838 -19.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1323 -18.7473 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8598 -17.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0428 -17.9979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8105 -18.7814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3183 -17.3016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1354 -17.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5462 -17.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3573 -17.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7628 -17.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3402 -16.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5294 -16.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5778 -17.2602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9792 -16.5484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9936 -17.9637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8013 -22.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8006 -23.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5071 -24.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2160 -23.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2183 -22.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
4 12 1 0
12 13 1 0
7 1 1 0
1 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
18 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 2 0
28 30 1 0
25 28 1 0
14 31 1 0
14 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M CHG 2 28 1 30 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.61Molecular Weight (Monoisotopic): 519.1246AlogP: 3.97#Rotatable Bonds: 9Polar Surface Area: 136.79Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.94CX Basic pKa: 0.58CX LogP: 3.36CX LogD: 3.35Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.87
References 1. Camoutsis C, Geronikaki A, Ciric A, Soković M, Zoumpoulakis P, Zervou M.. (2010) Sulfonamide-1,2,4-thiadiazole derivatives as antifungal and antibacterial agents: synthesis, biological evaluation, lipophilicity, and conformational studies., 58 (2): [PMID:20118573 ] [10.1248/cpb.58.160 ]