(4-chlorophenyl)(diethoxyphosphoryl)methyl 2-(3-(trifluoromethyl)phenoxy)acetate

ID: ALA2271096

PubChem CID: 76326911

Max Phase: Preclinical

Molecular Formula: C20H21ClF3O6P

Molecular Weight: 480.80

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=O)(OCC)C(OC(=O)COc1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C20H21ClF3O6P/c1-3-28-31(26,29-4-2)19(14-8-10-16(21)11-9-14)30-18(25)13-27-17-7-5-6-15(12-17)20(22,23)24/h5-12,19H,3-4,13H2,1-2H3

Standard InChI Key:  YZYKWEFLBFITST-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   37.7889   -4.2056    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   37.3762   -4.9114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1885   -4.9103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1291   -4.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1279   -5.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8360   -5.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5456   -5.0453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5428   -4.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8342   -3.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2490   -3.8114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9582   -4.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6644   -3.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3736   -4.2120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6613   -2.9889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0798   -3.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0767   -2.9835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4947   -3.7937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.0057   -4.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7808   -5.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4213   -3.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4211   -3.0006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.7136   -4.2266    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.7107   -3.4091    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.7829   -2.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7802   -1.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0704   -1.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3619   -1.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3681   -2.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0662   -0.5372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.3683   -6.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4088   -5.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15  1  1  0
 15 16  1  0
  1 17  2  0
  3 18  1  0
  2 19  1  0
  4 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 16 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 16  1  0
 26 29  1  0
 19 30  1  0
 18 31  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2271096

   [(4-Chlorophenyl)-diethoxyphosphorylmethyl] 2-[3-(trifluoromethyl)phenoxy]acetate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 480.80

Molecular Weight (Monoisotopic): 480.0716

AlogP: 6.25

#Rotatable Bonds: 10

Polar Surface Area: 71.06

Molecular Species: NEUTRAL

HBA: 6

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.32

CX LogD: 5.32

Aromatic Rings: 2

Heavy Atoms: 31

QED Weighted: 0.30

Np Likeness Score: -0.94

References

1. He H, Chen T, Li Y.  (2007)  Synthesis and herbicidal activity of alkyl 1-(3-trifluoromethylphenoxyacetoxy)-1-substituted methylphosphonates,  32  (1): [10.1584/jpestics.G06-05]

Source

Source(1):

• Scientific Literature