The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-chlorophenyl)(diethoxyphosphoryl)methyl 2-(3-(trifluoromethyl)phenoxy)acetate ID: ALA2271096
PubChem CID: 76326911
Max Phase: Preclinical
Molecular Formula: C20H21ClF3O6P
Molecular Weight: 480.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)C(OC(=O)COc1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C20H21ClF3O6P/c1-3-28-31(26,29-4-2)19(14-8-10-16(21)11-9-14)30-18(25)13-27-17-7-5-6-15(12-17)20(22,23)24/h5-12,19H,3-4,13H2,1-2H3
Standard InChI Key: YZYKWEFLBFITST-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
37.7889 -4.2056 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
37.3762 -4.9114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1885 -4.9103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1291 -4.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1279 -5.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8360 -5.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5456 -5.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5428 -4.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8342 -3.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2490 -3.8114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9582 -4.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6644 -3.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3736 -4.2120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6613 -2.9889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0798 -3.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0767 -2.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4947 -3.7937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0057 -4.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7808 -5.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4213 -3.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4211 -3.0006 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.7136 -4.2266 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.7107 -3.4091 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.7829 -2.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7802 -1.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0704 -1.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3619 -1.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3681 -2.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0662 -0.5372 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.3683 -6.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4088 -5.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 1 1 0
15 16 1 0
1 17 2 0
3 18 1 0
2 19 1 0
4 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
16 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 16 1 0
26 29 1 0
19 30 1 0
18 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.80Molecular Weight (Monoisotopic): 480.0716AlogP: 6.25#Rotatable Bonds: 10Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.32CX LogD: 5.32Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.30Np Likeness Score: -0.94
References 1. He H, Chen T, Li Y. (2007) Synthesis and herbicidal activity of alkyl 1-(3-trifluoromethylphenoxyacetoxy)-1-substituted methylphosphonates, 32 (1): [10.1584/jpestics.G06-05 ]