benzo[d][1,3]dioxol-5-yl(dimethoxyphosphoryl)methyl 2-(3-(trifluoromethyl)phenoxy)acetate

ID: ALA2271097

PubChem CID: 76308783

Max Phase: Preclinical

Molecular Formula: C19H18F3O8P

Molecular Weight: 462.31

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COP(=O)(OC)C(OC(=O)COc1cccc(C(F)(F)F)c1)c1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C19H18F3O8P/c1-25-31(24,26-2)18(12-6-7-15-16(8-12)29-11-28-15)30-17(23)10-27-14-5-3-4-13(9-14)19(20,21)22/h3-9,18H,10-11H2,1-2H3

Standard InChI Key:  NNZZQADHZQRJJJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   18.4941  -10.2644    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   18.0814  -10.9702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8937  -10.9690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8343  -10.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8331  -11.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5412  -11.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2508  -11.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2480  -10.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5394   -9.8762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9542   -9.8702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6634  -10.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3696   -9.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0788  -10.2708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3665   -9.0476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7850   -9.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7819   -9.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1999   -9.8525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7109  -10.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4860  -11.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1265   -9.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1263   -9.0594    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4188  -10.2854    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4159   -9.4679    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.4881   -8.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0671   -7.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0733   -8.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7756   -7.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4834   -7.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0845   -7.2662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7482   -6.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9393   -6.6157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15  1  1  0
 15 16  1  0
  1 17  2  0
  3 18  1  0
  2 19  1  0
  4 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 16 24  2  0
 24 28  1  0
 27 25  1  0
 25 26  2  0
 26 16  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2271097

   [1,3-Benzodioxol-5-yl(dimethoxyphosphoryl)methyl] 2-[3-(trifluoromethyl)phenoxy]acetate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 462.31

Molecular Weight (Monoisotopic): 462.0691

AlogP: 4.54

#Rotatable Bonds: 8

Polar Surface Area: 89.52

Molecular Species: NEUTRAL

HBA: 8

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.74

CX LogD: 3.74

Aromatic Rings: 2

Heavy Atoms: 31

QED Weighted: 0.42

Np Likeness Score: -0.69

References

1. He H, Chen T, Li Y.  (2007)  Synthesis and herbicidal activity of alkyl 1-(3-trifluoromethylphenoxyacetoxy)-1-substituted methylphosphonates,  32  (1): [10.1584/jpestics.G06-05]

Source

Source(1):

• Scientific Literature