1-(4-chlorophenyl)-6-methyl-3-(5-(3-(trifluoromethyl)phenylamino)-1,3,4-oxadiazol-2-yl)pyridazin-4(1H)-one

ID: ALA2271171

PubChem CID: 10972358

Max Phase: Preclinical

Molecular Formula: C20H13ClF3N5O2

Molecular Weight: 447.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)c(-c2nnc(Nc3cccc(C(F)(F)F)c3)o2)nn1-c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C20H13ClF3N5O2/c1-11-9-16(30)17(28-29(11)15-7-5-13(21)6-8-15)18-26-27-19(31-18)25-14-4-2-3-12(10-14)20(22,23)24/h2-10H,1H3,(H,25,27)

Standard InChI Key:  MTUQOSFUQKCPNU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   12.5247   -3.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5236   -4.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2316   -4.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9413   -4.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9385   -3.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2298   -3.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6498   -3.0079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3553   -3.4155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0651   -3.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0665   -2.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3565   -1.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6496   -2.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7804   -1.7705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7717   -3.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8186   -4.2268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6102   -4.4354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0537   -3.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5337   -3.1126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8702   -3.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2413   -2.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0568   -2.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4279   -2.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9835   -1.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1640   -1.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7967   -2.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2440   -2.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6883   -2.8510    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.6158   -1.4375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.0600   -2.1627    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8155   -4.6449    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.9417   -1.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 10 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
  9 14  1  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 22 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  2 30  1  0
 12 31  1  0
M  END

Associated Targets(non-human)

Puccinia recondita (281 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.80Molecular Weight (Monoisotopic): 447.0710AlogP: 5.01#Rotatable Bonds: 4
Polar Surface Area: 85.84Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.43CX Basic pKa: CX LogP: 5.21CX LogD: 4.93
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -2.11

References

1. Zou XJ, Lai LH, Jin GY, Zhang ZX..  (2002)  Synthesis, fungicidal activity, and 3D-QSAR of pyridazinone-substituted 1,3,4-oxadiazoles and 1,3,4-thiadiazoles.,  50  (13): [PMID:12059155] [10.1021/jf0201677]

Source