The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-(2-fluorophenylamino)-1,3,4-oxadiazol-2-yl)-6-methyl-1-(2,4,5-trichlorophenyl)pyridazin-4(1H)-one ID: ALA2271173
PubChem CID: 11081119
Max Phase: Preclinical
Molecular Formula: C19H11Cl3FN5O2
Molecular Weight: 466.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)c(-c2nnc(Nc3ccccc3F)o2)nn1-c1cc(Cl)c(Cl)cc1Cl
Standard InChI: InChI=1S/C19H11Cl3FN5O2/c1-9-6-16(29)17(27-28(9)15-8-11(21)10(20)7-12(15)22)18-25-26-19(30-18)24-14-5-3-2-4-13(14)23/h2-8H,1H3,(H,24,26)
Standard InChI Key: FSZCUXGARPSNJY-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
12.8797 -8.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8785 -9.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5866 -10.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2962 -9.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2934 -8.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5848 -8.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0048 -8.4641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7102 -8.8717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4200 -8.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4215 -7.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7114 -7.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0045 -7.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1354 -7.2267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1267 -8.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1735 -9.6830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9652 -9.8915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4086 -9.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8886 -8.5688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2252 -9.1562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5963 -8.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4117 -8.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7828 -7.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3384 -6.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5190 -7.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1516 -7.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1705 -10.1011 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.8550 -9.0762 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0046 -10.1001 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.1719 -8.4651 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.2966 -7.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
10 13 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
9 14 1 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
2 26 1 0
21 27 1 0
4 28 1 0
1 29 1 0
12 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.69Molecular Weight (Monoisotopic): 464.9962AlogP: 5.43#Rotatable Bonds: 4Polar Surface Area: 85.84Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.92CX Basic pKa: ┄CX LogP: 5.69CX LogD: 4.43Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -1.98
References 1. Zou XJ, Lai LH, Jin GY, Zhang ZX.. (2002) Synthesis, fungicidal activity, and 3D-QSAR of pyridazinone-substituted 1,3,4-oxadiazoles and 1,3,4-thiadiazoles., 50 (13): [PMID:12059155 ] [10.1021/jf0201677 ]