Tianshic acid

ID: ALA2271639

PubChem CID: 5321949

Max Phase: Preclinical

Molecular Formula: C18H34O5

Molecular Weight: 330.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC(O)C(O)/C=C/C(O)CCCCCCC(=O)O

Standard InChI:  InChI=1S/C18H34O5/c1-2-3-4-8-11-16(20)17(21)14-13-15(19)10-7-5-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+

Standard InChI Key:  YFCZLXRIKFCQFU-BUHFOSPRSA-N

Molfile:  

     RDKit          2D

 23 22  0  0  0  0  0  0  0  0999 V2000
    8.5390  -11.9295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2530  -11.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9670  -11.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6811  -11.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3950  -11.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1091  -11.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8231  -11.9170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5371  -11.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2511  -11.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9651  -11.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6791  -11.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3932  -11.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1072  -11.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8212  -11.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5353  -11.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2492  -11.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9633  -11.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6772  -11.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3913  -10.6685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1090  -12.7312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2529  -12.7396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3937  -11.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2511  -10.6894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 12 19  1  0
 13 20  1  0
  9 21  1  0
 18 22  1  0
  2 23  2  0
M  END

Alternative Forms

  1. Parent:

    ALA2271639

    TIANSHIC ACID

Associated Targets(non-human)

Phytophthora capsici (336 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.47Molecular Weight (Monoisotopic): 330.2406AlogP: 3.02#Rotatable Bonds: 15
Polar Surface Area: 97.99Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 4.74CX Basic pKa: CX LogP: 3.25CX LogD: 0.64
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.27Np Likeness Score: 1.68

References

1. Sang S, Lao A, Wang Y, Chin CK, Rosen RT, Ho CT..  (2002)  Antifungal constituents from the seeds of Allium fistulosum L.,  50  (22): [PMID:12381110] [10.1021/jf025651o]

Source