The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-dihydroxypropyl 8,11,12-trihydroxyoctadec-9-enoate ID: ALA2271640
PubChem CID: 76323372
Max Phase: Preclinical
Molecular Formula: C21H40O7
Molecular Weight: 404.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(O)C(O)/C=C/C(O)CCCCCCC(=O)OCC(O)CO
Standard InChI: InChI=1S/C21H40O7/c1-2-3-4-8-11-19(25)20(26)14-13-17(23)10-7-5-6-9-12-21(27)28-16-18(24)15-22/h13-14,17-20,22-26H,2-12,15-16H2,1H3/b14-13+
Standard InChI Key: CCCZMBNHXALALI-BUHFOSPRSA-N
Molfile:
RDKit 2D
28 27 0 0 0 0 0 0 0 0999 V2000
7.0984 -4.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8124 -4.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5265 -4.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2405 -4.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9545 -4.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6685 -4.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3825 -4.8186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0966 -4.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8105 -4.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5246 -4.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2385 -4.8103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9526 -4.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6667 -4.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3806 -4.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0947 -4.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8086 -4.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5227 -4.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2367 -4.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9508 -3.5701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6685 -5.6328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8123 -5.6412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9532 -4.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8107 -3.5909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3819 -4.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6665 -4.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9500 -4.4202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6675 -5.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9519 -6.0738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
12 19 1 0
13 20 1 0
9 21 1 0
18 22 1 0
2 23 2 0
1 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.54Molecular Weight (Monoisotopic): 404.2774AlogP: 1.83#Rotatable Bonds: 18Polar Surface Area: 127.45Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.33CX Basic pKa: ┄CX LogP: 2.07CX LogD: 2.07Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.13Np Likeness Score: 1.67
References 1. Sang S, Lao A, Wang Y, Chin CK, Rosen RT, Ho CT.. (2002) Antifungal constituents from the seeds of Allium fistulosum L., 50 (22): [PMID:12381110 ] [10.1021/jf025651o ]