2,3-dihydroxypropyl 8,11,12-trihydroxyoctadec-9-enoate

ID: ALA2271640

PubChem CID: 76323372

Max Phase: Preclinical

Molecular Formula: C21H40O7

Molecular Weight: 404.54

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCCCC(O)C(O)/C=C/C(O)CCCCCCC(=O)OCC(O)CO

Standard InChI:  InChI=1S/C21H40O7/c1-2-3-4-8-11-19(25)20(26)14-13-17(23)10-7-5-6-9-12-21(27)28-16-18(24)15-22/h13-14,17-20,22-26H,2-12,15-16H2,1H3/b14-13+

Standard InChI Key:  CCCZMBNHXALALI-BUHFOSPRSA-N

Molfile:  

     RDKit          2D

 28 27  0  0  0  0  0  0  0  0999 V2000
    7.0984   -4.8311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8124   -4.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5265   -4.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2405   -4.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9545   -4.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6685   -4.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3825   -4.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0966   -4.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8105   -4.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5246   -4.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2385   -4.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9526   -4.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6667   -4.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3806   -4.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0947   -4.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8086   -4.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5227   -4.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2367   -4.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9508   -3.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6685   -5.6328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8123   -5.6412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9532   -4.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8107   -3.5909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3819   -4.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6665   -4.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -4.4202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6675   -5.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9519   -6.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 12 19  1  0
 13 20  1  0
  9 21  1  0
 18 22  1  0
  2 23  2  0
  1 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2271640

   2,3-dihydroxypropyl (E)-8,11,12-trihydroxyoctadec-9-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 404.54

Molecular Weight (Monoisotopic): 404.2774

AlogP: 1.83

#Rotatable Bonds: 18

Polar Surface Area: 127.45

Molecular Species: NEUTRAL

HBA: 7

HBD: 5

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 5

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 13.33

CX Basic pKa: ┄

CX LogP: 2.07

CX LogD: 2.07

Aromatic Rings: ┄

Heavy Atoms: 28

QED Weighted: 0.13

Np Likeness Score: 1.67

References

1. Sang S, Lao A, Wang Y, Chin CK, Rosen RT, Ho CT..  (2002)  Antifungal constituents from the seeds of Allium fistulosum L.,  50  (22): [PMID:12381110] [10.1021/jf025651o]

Source

Source(1):

• Scientific Literature