The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-detigloylisoswietemahonin G ID: ALA2271724
PubChem CID: 76312532
Max Phase: Preclinical
Molecular Formula: C27H34O9
Molecular Weight: 502.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C(O)[C@H]1C(C)(C)[C@@H](O)[C@@H]2C(=O)[C@]1(C)[C@H]1CC[C@]3(C)[C@@H](CC(=O)O[C@H]3c3ccoc3)[C@]13O[C@@H]23
Standard InChI: InChI=1S/C27H34O9/c1-24(2)18(17(29)23(32)33-5)26(4)13-6-8-25(3)14(10-15(28)35-21(25)12-7-9-34-11-12)27(13)22(36-27)16(19(24)30)20(26)31/h7,9,11,13-14,16-19,21-22,29-30H,6,8,10H2,1-5H3/t13-,14-,16-,17?,18+,19+,21+,22+,25-,26-,27-/m1/s1
Standard InChI Key: VXGKLPCLRJEILZ-LWJYOGFISA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
9.4821 -17.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1967 -16.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8876 -15.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5651 -18.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8231 -18.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1461 -15.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3485 -13.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1922 -13.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5330 -17.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0945 -15.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1273 -14.6904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9634 -16.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8588 -15.9158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9307 -17.8779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5986 -14.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4109 -19.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1823 -17.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4438 -14.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3797 -15.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4658 -16.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6223 -15.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6864 -14.1790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5819 -13.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7006 -16.1729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4285 -12.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6521 -12.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7316 -11.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3821 -10.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0977 -10.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6441 -11.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3411 -19.8577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7276 -16.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2423 -15.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5220 -17.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4665 -16.3536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2963 -17.3801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
4 5 1 0
5 34 1 0
6 3 1 0
6 33 1 0
6 8 1 1
33 19 1 0
18 7 1 0
7 8 1 0
5 9 1 1
3 9 1 0
2 10 1 6
10 11 1 0
10 12 1 0
12 13 1 0
12 14 2 0
3 15 1 6
1 16 1 0
1 17 1 0
18 19 1 0
18 23 1 0
19 20 1 1
20 21 1 0
21 22 1 0
22 23 1 0
21 24 2 0
18 25 1 6
27 28 1 0
26 27 2 0
28 29 1 0
29 30 2 0
30 26 1 0
23 26 1 6
4 31 1 6
13 32 1 0
34 33 1 0
34 35 1 1
33 35 1 6
9 36 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.56Molecular Weight (Monoisotopic): 502.2203AlogP: 2.19#Rotatable Bonds: 3Polar Surface Area: 135.80Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.41CX Basic pKa: ┄CX LogP: 1.78CX LogD: 1.78Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: 2.88
References 1. Fowles R, Mootoo B, Ramsewak R, Khan A, Ramsubhag A, Reynolds W, Nair M.. (2010) Identification of new limonoids from Swietenia and their biological activity against insects., 66 (12): [PMID:20799251 ] [10.1002/ps.2013 ]