The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-O-benzoylswietenolide ID: ALA2271729
PubChem CID: 76334218
Max Phase: Preclinical
Molecular Formula: C34H38O9
Molecular Weight: 590.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](C(=O)Oc1ccccc1)[C@H]1C(C)(C)[C@H](O)[C@@H]2CC3=C4CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@@H]3[C@@]1(C)C2=O
Standard InChI: InChI=1S/C34H38O9/c1-32(2)26(25(30(38)40-5)31(39)42-19-9-7-6-8-10-19)34(4)22-11-13-33(3)23(20(22)15-21(27(32)36)28(34)37)16-24(35)43-29(33)18-12-14-41-17-18/h6-10,12,14,17,21-22,25-27,29,36H,11,13,15-16H2,1-5H3/t21-,22-,25+,26-,27+,29-,33+,34+/m0/s1
Standard InChI Key: LERBVZVAFKKHIN-DYZIJIDZSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
20.7512 -13.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5686 -12.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0104 -11.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4454 -13.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2553 -13.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7003 -12.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8205 -11.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5215 -11.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5891 -10.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8497 -10.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0668 -12.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8733 -12.2886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8611 -11.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8813 -10.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1348 -12.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4287 -11.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1147 -13.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8245 -10.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7066 -13.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9180 -12.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2942 -10.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2544 -11.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9520 -11.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6915 -11.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7313 -10.6253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0274 -10.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3863 -11.9081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2823 -9.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0671 -9.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7601 -8.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5378 -8.0933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7144 -8.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4252 -8.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3018 -14.2716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7024 -12.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1838 -10.5264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0913 -10.1571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2037 -9.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9213 -9.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9415 -8.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2435 -8.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5236 -8.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5069 -9.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
1 4 1 0
4 5 1 0
5 6 1 1
6 8 1 0
7 3 1 0
7 8 1 0
7 10 1 1
8 22 2 0
21 9 1 0
9 10 1 0
5 11 1 0
3 11 1 0
11 12 2 0
2 13 1 0
13 14 1 6
13 15 1 0
15 16 1 0
15 17 2 0
3 18 1 6
1 19 1 0
1 20 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 2 0
21 28 1 6
30 31 1 0
29 30 2 0
31 32 1 0
32 33 2 0
33 29 1 0
26 29 1 6
4 34 1 1
16 35 1 0
14 36 1 0
14 37 2 0
36 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.67Molecular Weight (Monoisotopic): 590.2516AlogP: 4.99#Rotatable Bonds: 5Polar Surface Area: 129.34Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.58CX LogD: 4.58Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: 2.18
References 1. Fowles R, Mootoo B, Ramsewak R, Khan A, Ramsubhag A, Reynolds W, Nair M.. (2010) Identification of new limonoids from Swietenia and their biological activity against insects., 66 (12): [PMID:20799251 ] [10.1002/ps.2013 ]