propyl 2-(1,3-dioxoisoindolin-2-yloxy)propanoate

ID: ALA2272238

PubChem CID: 76323430

Max Phase: Preclinical

Molecular Formula: C14H15NO5

Molecular Weight: 277.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCOC(=O)C(C)ON1C(=O)c2ccccc2C1=O

Standard InChI:  InChI=1S/C14H15NO5/c1-3-8-19-14(18)9(2)20-15-12(16)10-6-4-5-7-11(10)13(15)17/h4-7,9H,3,8H2,1-2H3

Standard InChI Key:  GEHVCRQGEFRUEI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
    8.7569  -15.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7558  -16.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4706  -16.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4687  -15.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1841  -15.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1844  -16.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9749  -16.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4646  -15.8649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9745  -15.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2291  -14.4088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2300  -17.3227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1816  -15.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8936  -15.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6105  -15.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3225  -15.8824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6156  -14.6406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3174  -16.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8885  -16.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6004  -17.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5958  -17.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  7 11  2  0
  8 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 13 18  1  0
 17 19  1  0
 19 20  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Lepidium sativum (398 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 277.28Molecular Weight (Monoisotopic): 277.0950AlogP: 1.56#Rotatable Bonds: 5
Polar Surface Area: 72.91Molecular Species: HBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.14CX LogD: 2.14
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.60Np Likeness Score: -0.33

References

1. Takekida Y, Okazaki M, Shuto Y..  (1999)  Effect of Optically Active Ethyl 2-Phthalimidooxypropionate on the Growth of Cress, Lepidium sativum.,  63  (10): [PMID:26300175] [10.1271/bbb.63.1831]

Source