The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Hydroxymexicanolide ID: ALA2272737
PubChem CID: 60200692
Max Phase: Preclinical
Molecular Formula: C27H32O8
Molecular Weight: 484.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](O)[C@H]1C(C)(C)C(=O)[C@@H]2CC3=C4CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@@H]3[C@@]1(C)C2=O
Standard InChI: InChI=1S/C27H32O8/c1-25(2)20(19(29)24(32)33-5)27(4)16-6-8-26(3)17(14(16)10-15(21(25)30)22(27)31)11-18(28)35-23(26)13-7-9-34-12-13/h7,9,12,15-16,19-20,23,29H,6,8,10-11H2,1-5H3/t15-,16-,19+,20-,23-,26+,27+/m0/s1
Standard InChI Key: XEHMUYDSKXRHFC-POLOUJCESA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
5.6877 -16.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1168 -13.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1168 -14.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8289 -14.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8289 -13.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5409 -13.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5374 -14.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2462 -14.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9630 -14.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9666 -13.5481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2532 -13.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2567 -12.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9255 -11.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6728 -11.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8478 -11.0382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5907 -11.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4030 -14.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8298 -15.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1157 -16.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6877 -15.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3996 -16.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1117 -15.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9726 -14.7847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2587 -15.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5436 -14.7867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2598 -16.0232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8297 -15.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9738 -16.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6834 -16.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3960 -13.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5336 -12.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6752 -14.7895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4877 -14.9795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4019 -17.2545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9715 -13.9597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 1
2 5 1 0
3 4 1 0
4 7 2 0
6 5 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
11 12 1 6
3 17 1 0
4 18 1 0
19 18 1 1
20 1 1 6
20 17 1 0
1 21 1 0
21 19 1 0
19 22 1 0
22 17 1 0
20 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
1 28 1 0
1 29 1 0
17 30 1 6
6 31 1 6
9 32 2 0
22 33 2 0
21 34 2 0
23 35 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.55Molecular Weight (Monoisotopic): 484.2097AlogP: 3.33#Rotatable Bonds: 3Polar Surface Area: 120.11Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.41CX Basic pKa: ┄CX LogP: 3.16CX LogD: 3.16Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: 2.81
References 1. Li J, Li MY, Feng G, Zhang J, Karonen M, Sinkkonen J, Satyanandamurty T, Wu J.. (2012) Moluccensins R-Y, limonoids from the seeds of a mangrove, Xylocarpus moluccensis., 75 (7): [PMID:22724531 ] [10.1021/np300053f ]