(Z)-ethoxyethyl 2-cyano-3-methylthio-3-(4-chlorophenyl)methaneaminoacrylate

ID: ALA2272998

PubChem CID: 76330729

Max Phase: Preclinical

Molecular Formula: C16H19ClN2O3S

Molecular Weight: 354.86

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOCCOC(=O)/C(C#N)=C(/NCc1ccc(Cl)cc1)SC

Standard InChI:  InChI=1S/C16H19ClN2O3S/c1-3-21-8-9-22-16(20)14(10-18)15(23-2)19-11-12-4-6-13(17)7-5-12/h4-7,19H,3,8-9,11H2,1-2H3/b15-14-

Standard InChI Key:  FICDJBNUICCGFJ-PFONDFGASA-N

Molfile:  

     RDKit          2D

 23 23  0  0  0  0  0  0  0  0999 V2000
    2.2204  -28.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0358  -28.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4427  -27.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0353  -26.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2168  -26.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8136  -27.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9964  -27.5119    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.2599  -27.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6683  -28.2157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4855  -28.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8939  -28.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7111  -28.9239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4852  -29.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0783  -30.3399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1196  -29.6317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1199  -28.2163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8943  -27.5083    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.9368  -29.6319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3452  -30.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1624  -30.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5711  -29.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3883  -29.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4859  -26.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  3  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  3  0
 12 15  1  0
 12 16  2  0
 10 17  1  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 23  1  0
M  END

Associated Targets(non-human)

Medicago sativa (511 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.86Molecular Weight (Monoisotopic): 354.0805AlogP: 3.11#Rotatable Bonds: 9
Polar Surface Area: 71.35Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.75CX LogD: 3.75
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.32Np Likeness Score: -1.28

References

1. Wang Q, Sun H, Cao H, Cheng M, Huang R..  (2003)  Synthesis and herbicidal activity of 2-cyano-3-substituted-pyridinemethylaminoacrylates.,  51  (17): [PMID:12903965] [10.1021/jf034067s]

Source