The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sodium salt 2-isopropyl-8-methoxy-5-methyl-4-oxo-4,5-dihydro-furo[3,2-c]quinoline-3-sulfonate ID: ALA22783
PubChem CID: 23679485
Max Phase: Preclinical
Molecular Formula: C16H16NNaO6S
Molecular Weight: 351.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c1oc(C(C)C)c(S(=O)(=O)[O-])c1c(=O)n2C.[Na+]
Standard InChI: InChI=1S/C16H17NO6S.Na/c1-8(2)13-15(24(19,20)21)12-14(23-13)10-7-9(22-4)5-6-11(10)17(3)16(12)18;/h5-8H,1-4H3,(H,19,20,21);/q;+1/p-1
Standard InChI Key: IKPYYHZFZRCAHG-UHFFFAOYSA-M
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
4.0667 -1.5167 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
2.2917 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7417 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7667 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2917 -1.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -0.6667 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5042 0.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7667 -1.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9000 -0.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 -1.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1542 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7250 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4750 -0.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8917 -0.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8125 -1.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7250 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8000 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7625 -2.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2042 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2042 -1.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3125 -0.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 0.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 1.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8333 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 2 2 0
5 2 1 0
6 3 1 0
7 3 2 0
8 5 1 0
9 4 1 0
10 4 1 0
11 8 1 0
12 6 1 0
13 11 2 0
14 6 2 0
15 6 2 0
16 5 2 0
17 9 2 0
18 7 1 0
19 8 1 0
20 17 1 0
21 13 1 0
22 20 1 0
23 18 1 0
24 18 1 0
25 22 1 0
7 10 1 0
9 11 1 0
20 21 2 0
M CHG 2 1 1 12 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 351.38Molecular Weight (Monoisotopic): 351.0777AlogP: 2.66#Rotatable Bonds: 3Polar Surface Area: 98.74Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: -2.04CX Basic pKa: ┄CX LogP: -0.15CX LogD: -0.60Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.73Np Likeness Score: -0.14
References 1. Butenschön I, Möller K, Hänsel W.. (2001) Angular methoxy-substituted furo- and pyranoquinolinones as blockers of the voltage-gated potassium channel Kv1.3., 44 (8): [PMID:11312924 ] [10.1021/jm001007u ]