The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,12-bis(4-N,N-dimethylaminopyridinium)dodecane dibromide ID: ALA228000
Cas Number: 936498-64-5
PubChem CID: 44423477
Max Phase: Preclinical
Molecular Formula: C26H44Br2N4
Molecular Weight: 412.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cc[n+](CCCCCCCCCCCC[n+]2ccc(N(C)C)cc2)cc1.[Br-].[Br-]
Standard InChI: InChI=1S/C26H44N4.2BrH/c1-27(2)25-15-21-29(22-16-25)19-13-11-9-7-5-6-8-10-12-14-20-30-23-17-26(18-24-30)28(3)4;;/h15-18,21-24H,5-14,19-20H2,1-4H3;2*1H/q+2;;/p-2
Standard InChI Key: SRYRXSJEWKGQSC-UHFFFAOYSA-L
Molfile:
RDKit 2D
32 31 0 0 0 0 0 0 0 0999 V2000
5.6875 -7.3125 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.7973 -9.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7984 -10.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0836 -10.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3672 -10.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3700 -9.1963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0854 -8.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6571 -8.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0589 -9.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7718 -8.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4878 -9.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2008 -8.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9168 -9.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6297 -8.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3457 -9.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0586 -8.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5132 -10.4393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7746 -9.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4875 -8.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2036 -9.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9165 -8.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6295 -9.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3420 -8.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3393 -7.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6183 -7.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9088 -7.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0517 -7.5034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7682 -7.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5139 -11.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2274 -10.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0475 -6.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1562 -7.2500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
4 5 2 0
3 17 1 0
8 9 1 0
16 18 1 0
18 19 1 0
9 10 1 0
19 20 1 0
5 6 1 0
20 21 1 0
10 11 1 0
21 22 2 0
3 4 1 0
22 23 1 0
11 12 1 0
23 24 2 0
6 7 2 0
24 25 1 0
12 13 1 0
25 26 2 0
26 21 1 0
7 2 1 0
24 27 1 0
13 14 1 0
27 28 1 0
2 3 2 0
17 29 1 0
14 15 1 0
17 30 1 0
6 8 1 0
27 31 1 0
M CHG 4 1 -1 6 1 21 1 32 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.67Molecular Weight (Monoisotopic): 412.3555AlogP: 4.99#Rotatable Bonds: 15Polar Surface Area: 14.24Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.43CX LogP: -2.20CX LogD: -2.20Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -0.24
References 1. Ng CK, Singhal V, Widmer F, Wright LC, Sorrell TC, Jolliffe KA.. (2007) Synthesis, antifungal and haemolytic activity of a series of bis(pyridinium)alkanes., 15 (10): [PMID:17383187 ] [10.1016/j.bmc.2007.03.018 ] 2. Trousil S, Carroll L, Kalusa A, Aberg O, Kaliszczak M, Aboagye EO.. (2013) Design of symmetrical and nonsymmetrical N,N-dimethylaminopyridine derivatives as highly potent choline kinase alpha inhibitors., 4 (4): [PMID:24976941 ] [10.1039/c3md00068k ]