The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{N,N-bis(2'-chloroethyl)}aminoacetamido-5-chlorobenzophenone ID: ALA2281460
PubChem CID: 72722179
Max Phase: Preclinical
Molecular Formula: C19H19Cl3N2O2
Molecular Weight: 413.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN(CCCl)CCCl)Nc1ccc(Cl)cc1C(=O)c1ccccc1
Standard InChI: InChI=1S/C19H19Cl3N2O2/c20-8-10-24(11-9-21)13-18(25)23-17-7-6-15(22)12-16(17)19(26)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,23,25)
Standard InChI Key: OFRJHULMIHXFMF-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
0.8736 -2.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8724 -3.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5805 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2901 -3.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2873 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5787 -2.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9935 -2.2141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9904 -1.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6965 -0.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2811 -0.9910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4058 -1.3916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1119 -0.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8212 -1.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5273 -0.9750 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.4089 -2.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1181 -2.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8243 -2.2035 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.9985 -3.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7055 -3.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9997 -4.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2914 -5.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2923 -5.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0012 -6.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7106 -5.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7062 -5.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1644 -3.8566 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
4 18 1 0
18 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
2 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.73Molecular Weight (Monoisotopic): 412.0512AlogP: 4.29#Rotatable Bonds: 9Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.62CX Basic pKa: 3.51CX LogP: 5.14CX LogD: 5.14Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.49Np Likeness Score: -1.42
References 1. Singh RK, Prasad DN, Bhardwaj TR. (2013) Design, synthesis and evaluation of aminobenzophenone derivatives containing nitrogen mustard moiety as potential central nervous system antitumor agent, 22 (12): [10.1007/s00044-013-0582-8 ]