The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-5-(thiophen-2-yl)-3H-imidazo[4,5-c]pyridin-4(5H)-one ID: ALA2281567
PubChem CID: 76316142
Max Phase: Preclinical
Molecular Formula: C28H25N7OS
Molecular Weight: 507.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc2ccn(-c3cccs3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1
Standard InChI: InChI=1S/C28H25N7OS/c1-2-3-9-24-29-23-15-16-34(25-10-6-17-37-25)28(36)26(23)35(24)18-19-11-13-20(14-12-19)21-7-4-5-8-22(21)27-30-32-33-31-27/h4-8,10-17H,2-3,9,18H2,1H3,(H,30,31,32,33)
Standard InChI Key: LINVQEDPWSEFTL-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
16.3477 -10.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0573 -9.9526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0545 -9.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3459 -8.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6396 -9.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6409 -9.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8647 -8.8830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3837 -9.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8627 -10.2041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3475 -11.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6090 -10.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1549 -11.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8998 -12.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4449 -12.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2454 -12.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4979 -12.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9511 -11.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7895 -13.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5353 -14.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0812 -14.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8815 -14.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1330 -13.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5853 -13.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5665 -9.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1589 -8.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3417 -8.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9342 -8.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7349 -14.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1270 -13.8076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4184 -14.2168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5886 -15.0173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4024 -15.1026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7657 -10.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8529 -11.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6525 -11.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0600 -10.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5122 -10.0241 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
8 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
19 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
2 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.62Molecular Weight (Monoisotopic): 507.1841AlogP: 5.49#Rotatable Bonds: 8Polar Surface Area: 94.28Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.23CX Basic pKa: 1.62CX LogP: 5.78CX LogD: 4.18Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.47
References 1. Sharma MC, Kohli DV. (2013) A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach, 22 (2): [10.1007/s00044-012-0040-z ]