3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-5-(4-bromobenzyl)-2-butyl-3H-imidazo[4,5-c]pyridin-4(5H)-one

ID: ALA2281568

PubChem CID: 76319863

Max Phase: Preclinical

Molecular Formula: C31H28BrN7O

Molecular Weight: 594.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(Cc3ccc(Br)cc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1

Standard InChI:  InChI=1S/C31H28BrN7O/c1-2-3-8-28-33-27-17-18-38(19-21-11-15-24(32)16-12-21)31(40)29(27)39(28)20-22-9-13-23(14-10-22)25-6-4-5-7-26(25)30-34-36-37-35-30/h4-7,9-18H,2-3,8,19-20H2,1H3,(H,34,35,36,37)

Standard InChI Key:  BNWWGRNEVVQGLC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    2.9755  -19.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6851  -19.1439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6823  -18.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9737  -17.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2674  -19.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2686  -18.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4924  -18.0744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0114  -18.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4905  -19.3955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9753  -20.3705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2368  -20.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7827  -20.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5275  -21.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0727  -22.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8732  -21.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1257  -21.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5789  -20.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4173  -22.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1631  -23.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7090  -23.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5093  -23.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7608  -23.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2131  -22.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3627  -23.5435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7548  -22.9989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0462  -23.4082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2164  -24.2086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0302  -24.2939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3935  -19.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1005  -19.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1943  -18.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2159  -18.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0331  -18.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4427  -17.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8056  -19.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5121  -19.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5113  -18.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7980  -17.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0943  -18.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2178  -17.9119    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
 29 30  1  0
  8 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 30 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 30  1  0
 37 40  1  0
M  END

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 594.52Molecular Weight (Monoisotopic): 593.1539AlogP: 6.25#Rotatable Bonds: 9
Polar Surface Area: 94.28Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.23CX Basic pKa: 1.85CX LogP: 6.66CX LogD: 5.06
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.27

References

1. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source