4-((3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-4-oxo-3H-imidazo[4,5-c]pyridin-5(4H)-yl)methyl)benzoic acid

ID: ALA2281573

PubChem CID: 19349840

Max Phase: Preclinical

Molecular Formula: C32H29N7O3

Molecular Weight: 559.63

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(Cc3ccc(C(=O)O)cc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1

Standard InChI:  InChI=1S/C32H29N7O3/c1-2-3-8-28-33-27-17-18-38(19-21-11-15-24(16-12-21)32(41)42)31(40)29(27)39(28)20-22-9-13-23(14-10-22)25-6-4-5-7-26(25)30-34-36-37-35-30/h4-7,9-18H,2-3,8,19-20H2,1H3,(H,41,42)(H,34,35,36,37)

Standard InChI Key:  YGDYDGDROSOSDT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
   14.2098  -27.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9194  -27.2787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9166  -26.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2080  -26.0508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5017  -27.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5029  -26.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7268  -26.2091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2458  -26.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7248  -27.5303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2096  -28.5053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4711  -28.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0170  -28.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7619  -29.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3070  -30.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1075  -30.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3600  -29.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8132  -28.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6516  -30.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3974  -31.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9433  -32.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7436  -31.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9951  -31.1636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4474  -30.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5970  -31.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9891  -31.1337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2805  -31.5429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4507  -32.3434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2645  -32.4287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6278  -27.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3349  -27.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4286  -26.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0210  -26.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2038  -26.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7962  -25.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0399  -27.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7465  -27.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7456  -26.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0323  -26.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3286  -26.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4521  -26.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1610  -26.4532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4498  -25.2295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
 29 30  1  0
  8 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 30 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 30  1  0
 37 40  1  0
 40 41  1  0
 40 42  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA2281573

   4-[[2-butyl-4-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridin-5-yl]methyl]benzoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 559.63

Molecular Weight (Monoisotopic): 559.2332

AlogP: 5.18

#Rotatable Bonds: 10

Polar Surface Area: 131.58

Molecular Species: ACID

HBA: 8

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 10

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.84

CX Basic pKa: 1.85

CX LogP: 5.55

CX LogD: 0.83

Aromatic Rings: 6

Heavy Atoms: 42

QED Weighted: 0.24

Np Likeness Score: -1.12

References

1. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source

Source(1):

• Scientific Literature