3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-5-pivaloyl-3H-imidazo[4,5-c]pyridin-4(5H)-one

ID: ALA2281575

PubChem CID: 76330744

Max Phase: Preclinical

Molecular Formula: C29H31N7O2

Molecular Weight: 509.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(C(=O)C(C)(C)C)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1

Standard InChI:  InChI=1S/C29H31N7O2/c1-5-6-11-24-30-23-16-17-35(28(38)29(2,3)4)27(37)25(23)36(24)18-19-12-14-20(15-13-19)21-9-7-8-10-22(21)26-31-33-34-32-26/h7-10,12-17H,5-6,11,18H2,1-4H3,(H,31,32,33,34)

Standard InChI Key:  FGWGRHGAVGEPLG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    3.9041   -2.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6137   -2.4740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6109   -1.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9023   -1.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1960   -2.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1973   -1.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4211   -1.4045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9401   -2.0644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4191   -2.7256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9039   -3.7007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1654   -3.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7113   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4562   -4.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0013   -5.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8019   -5.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0543   -4.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5075   -3.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3459   -5.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0917   -6.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6376   -7.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4380   -7.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6894   -6.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1418   -5.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2913   -6.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6834   -6.3291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9748   -6.7383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1450   -7.5387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9588   -7.6240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3221   -2.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0292   -2.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1229   -2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7153   -1.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1045   -1.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5141   -0.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7342   -2.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0229   -1.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3234   -3.6987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7315   -2.0554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
 29 30  1  0
  8 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 30 35  1  0
 36 30  1  0
 29 37  2  0
 30 38  1  0
M  END

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 509.61Molecular Weight (Monoisotopic): 509.2539AlogP: 5.12#Rotatable Bonds: 7
Polar Surface Area: 111.35Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.23CX Basic pKa: 1.77CX LogP: 5.74CX LogD: 4.14
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: -1.29

References

1. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source