The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-4-oxo-3H-imidazo[4,5-c]pyridine-5(4H)-carboxylate ID: ALA2281576
PubChem CID: 76334334
Max Phase: Preclinical
Molecular Formula: C26H25N7O3
Molecular Weight: 483.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc2ccn(C(=O)OC)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1
Standard InChI: InChI=1S/C26H25N7O3/c1-3-4-9-22-27-21-14-15-32(26(35)36-2)25(34)23(21)33(22)16-17-10-12-18(13-11-17)19-7-5-6-8-20(19)24-28-30-31-29-24/h5-8,10-15H,3-4,9,16H2,1-2H3,(H,28,29,30,31)
Standard InChI Key: ONIVDHBOCVXQHH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
11.8820 -2.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5917 -2.5071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5888 -1.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8802 -1.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1740 -2.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1752 -1.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3990 -1.4375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9180 -2.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3970 -2.7586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8818 -3.7337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1434 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6893 -4.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4341 -4.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9793 -5.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7798 -5.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0323 -4.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4854 -3.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3239 -5.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0696 -6.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6156 -7.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4159 -7.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6673 -6.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1197 -5.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2692 -6.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6614 -6.3621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9527 -6.7713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1230 -7.5717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9368 -7.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3000 -2.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0071 -2.5048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1008 -2.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6932 -1.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8761 -1.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4685 -0.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7121 -2.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3013 -3.7317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
19 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
2 29 1 0
29 30 1 0
8 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
30 35 1 0
29 36 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.53Molecular Weight (Monoisotopic): 483.2019AlogP: 4.05#Rotatable Bonds: 7Polar Surface Area: 120.58Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.23CX Basic pKa: 1.74CX LogP: 4.56CX LogD: 2.96Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.19
References 1. Sharma MC, Kohli DV. (2013) A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach, 22 (2): [10.1007/s00044-012-0040-z ]