3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-4-oxo-N-phenyl-3H-imidazo[4,5-c]pyridine-5(4H)-carboxamide

ID: ALA2281654

PubChem CID: 76323515

Max Phase: Preclinical

Molecular Formula: C31H28N8O2

Molecular Weight: 544.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(C(=O)Nc3ccccc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1

Standard InChI:  InChI=1S/C31H28N8O2/c1-2-3-13-27-33-26-18-19-38(31(41)32-23-9-5-4-6-10-23)30(40)28(26)39(27)20-21-14-16-22(17-15-21)24-11-7-8-12-25(24)29-34-36-37-35-29/h4-12,14-19H,2-3,13,20H2,1H3,(H,32,41)(H,34,35,36,37)

Standard InChI Key:  GLXIKKZOKSIUOH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   31.9321  -20.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6418  -19.8909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6389  -19.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9303  -18.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2241  -19.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2253  -19.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4491  -18.8214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9681  -19.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4471  -20.1425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9319  -21.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1934  -20.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7393  -21.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4842  -22.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0293  -22.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8299  -22.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0823  -21.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5355  -21.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3740  -23.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1197  -24.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6657  -24.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4660  -24.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7174  -23.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1698  -23.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3193  -24.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7114  -23.7460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0028  -24.1552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1730  -24.9556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9868  -25.0409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3501  -20.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0572  -19.8887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1509  -19.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7433  -18.7718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9261  -18.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5186  -18.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7622  -20.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3514  -21.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7560  -21.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4602  -21.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1670  -21.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1651  -20.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4604  -19.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
 29 30  1  0
  8 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 30 35  1  0
 29 36  2  0
 35 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 35  1  0
M  END

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.2335AlogP: 5.52#Rotatable Bonds: 8
Polar Surface Area: 123.38Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.23CX Basic pKa: 1.75CX LogP: 5.84CX LogD: 4.24
Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.26Np Likeness Score: -1.37

References

1. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source