The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-N-methyl-4-oxo-N-phenyl-3H-imidazo[4,5-c]pyridine-5(4H)-carboxamide ID: ALA2281655
PubChem CID: 76316155
Max Phase: Preclinical
Molecular Formula: C32H30N8O2
Molecular Weight: 558.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc2ccn(C(=O)N(C)c3ccccc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1
Standard InChI: InChI=1S/C32H30N8O2/c1-3-4-14-28-33-27-19-20-39(32(42)38(2)24-10-6-5-7-11-24)31(41)29(27)40(28)21-22-15-17-23(18-16-22)25-12-8-9-13-26(25)30-34-36-37-35-30/h5-13,15-20H,3-4,14,21H2,1-2H3,(H,34,35,36,37)
Standard InChI Key: GMJHZKGPPGXRKT-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
4.7997 -27.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5094 -27.2828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5065 -26.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7979 -26.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0916 -27.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0929 -26.4668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -26.2132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8357 -26.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3147 -27.5344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7995 -28.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0610 -28.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6069 -28.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3518 -29.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 -30.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6975 -30.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9499 -29.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4031 -28.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2416 -30.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9873 -31.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5333 -32.1192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3336 -31.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5850 -31.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0374 -30.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1869 -31.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5790 -31.1378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8704 -31.5470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0406 -32.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8544 -32.4328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2177 -27.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9248 -27.2806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0185 -26.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6109 -26.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7937 -26.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3862 -25.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6298 -27.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2190 -28.5075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6236 -28.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3278 -28.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0346 -28.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0327 -27.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3279 -27.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9245 -26.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
19 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
2 29 1 0
29 30 1 0
8 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
30 35 1 0
29 36 2 0
35 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 35 1 0
30 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.65Molecular Weight (Monoisotopic): 558.2492AlogP: 5.54#Rotatable Bonds: 8Polar Surface Area: 114.59Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.23CX Basic pKa: 1.75CX LogP: 5.71CX LogD: 4.11Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.26Np Likeness Score: -1.32
References 1. Sharma MC, Kohli DV. (2013) A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach, 22 (2): [10.1007/s00044-012-0040-z ]