3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-2-butyl-4-oxo-N,N-diphenyl-3H-imidazo[4,5-c]pyridine-5(4H)-carboxamide

ID: ALA2281656

PubChem CID: 76334344

Max Phase: Preclinical

Molecular Formula: C37H32N8O2

Molecular Weight: 620.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(C(=O)N(c3ccccc3)c3ccccc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1

Standard InChI:  InChI=1S/C37H32N8O2/c1-2-3-18-33-38-32-23-24-43(37(47)45(28-12-6-4-7-13-28)29-14-8-5-9-15-29)36(46)34(32)44(33)25-26-19-21-27(22-20-26)30-16-10-11-17-31(30)35-39-41-42-40-35/h4-17,19-24H,2-3,18,25H2,1H3,(H,39,40,41,42)

Standard InChI Key:  IQVSORZMXLQCSZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 47 53  0  0  0  0  0  0  0  0999 V2000
   15.1714  -27.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8811  -27.2209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8783  -26.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1696  -25.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4634  -27.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4646  -26.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6884  -26.1513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2074  -26.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6864  -27.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1712  -28.4475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4328  -28.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9787  -28.8574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7235  -29.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2687  -30.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0692  -30.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3217  -29.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7748  -28.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6133  -30.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3590  -31.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9050  -32.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7053  -31.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9567  -31.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4091  -30.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5586  -31.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9508  -31.0759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2421  -31.4851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4124  -32.2856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2262  -32.3709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5894  -27.6284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2965  -27.2187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3902  -26.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9827  -26.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1655  -26.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7579  -25.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0015  -27.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5907  -28.4456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9954  -28.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6995  -28.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4063  -28.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4044  -27.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6997  -27.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2962  -26.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0024  -25.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0025  -25.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2941  -24.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5842  -25.1831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5876  -25.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
 29 30  1  0
  8 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 30 35  1  0
 29 36  2  0
 35 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 35  1  0
 30 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 42  1  0
M  END

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 620.72Molecular Weight (Monoisotopic): 620.2648AlogP: 7.24#Rotatable Bonds: 9
Polar Surface Area: 114.59Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.23CX Basic pKa: 1.75CX LogP: 7.37CX LogD: 5.77
Aromatic Rings: 7Heavy Atoms: 47QED Weighted: 0.18Np Likeness Score: -1.13

References

1. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source