(4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-diyl)bis(phenylmethanone)

ID: ALA2281750

PubChem CID: 76334352

Max Phase: Preclinical

Molecular Formula: C27H22ClNO2

Molecular Weight: 427.93

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)c2ccccc2)C(c2ccccc2Cl)C(C(=O)c2ccccc2)=C(C)N1

Standard InChI:  InChI=1S/C27H22ClNO2/c1-17-23(26(30)19-11-5-3-6-12-19)25(21-15-9-10-16-22(21)28)24(18(2)29-17)27(31)20-13-7-4-8-14-20/h3-16,25,29H,1-2H3

Standard InChI Key:  LVMSGCIGEHKFLZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   12.5742   -5.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5731   -6.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2811   -7.2212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9908   -6.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9880   -5.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2794   -5.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8651   -7.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6992   -7.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6941   -5.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6911   -4.7607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8664   -5.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8662   -4.7671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2769   -4.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9822   -4.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9801   -3.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2707   -3.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5618   -3.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5674   -4.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4034   -5.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4031   -6.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1115   -7.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8187   -6.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8130   -5.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1040   -5.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1588   -5.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4511   -5.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7440   -5.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7438   -6.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4565   -7.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1608   -6.8069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8575   -3.9539    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  1  0
  2  7  1  0
  4  8  1  0
  5  9  1  0
  9 10  2  0
  1 11  1  0
 11 12  2  0
  6 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  9 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 11 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 18 31  1  0
M  END

Associated Targets(Human)

HSC-2 (771 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.93Molecular Weight (Monoisotopic): 427.1339AlogP: 6.34#Rotatable Bonds: 5
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.23CX LogD: 5.23
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -0.55

References

1. Amgoth SN, Porika M, Abbagani S, Garlapati A, Vanga MR.  (2013)  Synthesis, anticancer and MRP1 inhibitory activities of 4-alkyl/aryl-3,5-bis(carboethoxy/carbomethoxy)-1,4-dihydro-2,6-dimethylpyridines,  22  (1): [10.1007/s00044-012-9994-0]

Source