The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Fluorobiphenyl-4-yl)-N'-[(4-fluorophenyl)methylene]propanehydrazide ID: ALA2281797
PubChem CID: 76327095
Max Phase: Preclinical
Molecular Formula: C22H18F2N2O
Molecular Weight: 364.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)N/N=C/c1ccc(F)cc1)c1ccc(-c2ccccc2)c(F)c1
Standard InChI: InChI=1S/C22H18F2N2O/c1-15(22(27)26-25-14-16-7-10-19(23)11-8-16)18-9-12-20(21(24)13-18)17-5-3-2-4-6-17/h2-15H,1H3,(H,26,27)/b25-14+
Standard InChI Key: AZDVIHIVCDEJDS-AFUMVMLFSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
0.1967 -13.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1955 -14.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9036 -14.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6133 -14.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6104 -13.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9018 -12.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3136 -12.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0231 -13.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7288 -12.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7261 -12.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0119 -11.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3092 -12.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4318 -11.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1415 -12.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4276 -10.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1457 -12.9352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8471 -11.7058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5569 -12.1108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0253 -14.1711 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2625 -11.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9723 -12.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9711 -12.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6800 -13.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3866 -12.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3798 -12.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6703 -11.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0969 -13.3160 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
10 13 1 0
13 14 1 0
13 15 1 0
14 16 2 0
14 17 1 0
17 18 1 0
8 19 1 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 364.40Molecular Weight (Monoisotopic): 364.1387AlogP: 4.89#Rotatable Bonds: 5Polar Surface Area: 41.46Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.78CX Basic pKa: 1.46CX LogP: 5.42CX LogD: 5.42Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.51Np Likeness Score: -1.35
References 1. Ckla P, Tatar E, Kucukguzel I, Sahin F, Yurdakul D, Basu A, Krishnan R, Nichols DB, Kaushik-Basu N, Kucukguzel SG. (2013) Synthesis and characterization of flurbiprofen hydrazide derivatives as potential anti-HCV, anticancer and antimicrobial agents, 22 (12): [10.1007/s00044-013-0550-3 ]