The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Fluoro-4-biphenylyl)-N-[2-(4-nitrophenyl)-4-oxo-1,3-thiazolidine-3-yl]propanamide ID: ALA2281803
PubChem CID: 76316168
Max Phase: Preclinical
Molecular Formula: C24H20FN3O4S
Molecular Weight: 465.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)NN1C(=O)CSC1c1ccc([N+](=O)[O-])cc1)c1ccc(-c2ccccc2)c(F)c1
Standard InChI: InChI=1S/C24H20FN3O4S/c1-15(18-9-12-20(21(25)13-18)16-5-3-2-4-6-16)23(30)26-27-22(29)14-33-24(27)17-7-10-19(11-8-17)28(31)32/h2-13,15,24H,14H2,1H3,(H,26,30)
Standard InChI Key: FEPGGAGLTYILJF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
24.7207 -20.1285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7195 -20.9480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4276 -21.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1372 -20.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1344 -20.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4258 -19.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8375 -19.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5471 -20.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2528 -19.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2501 -18.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5359 -18.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8332 -18.9011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9557 -18.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6655 -18.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9516 -17.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6697 -19.7039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3711 -18.4745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0809 -18.8795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5493 -20.9397 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.1673 -19.6888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9675 -19.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3725 -19.1448 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.8225 -18.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5618 -20.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9859 -17.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7626 -17.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9267 -16.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3149 -16.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5364 -16.4037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3761 -17.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4800 -15.3371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8679 -14.7957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2549 -15.0777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
10 13 1 0
13 14 1 0
13 15 1 0
14 16 2 0
14 17 1 0
17 18 1 0
8 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 18 1 0
20 24 2 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
23 25 1 0
31 32 2 0
31 33 1 0
28 31 1 0
M CHG 2 31 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.51Molecular Weight (Monoisotopic): 465.1159AlogP: 4.81#Rotatable Bonds: 6Polar Surface Area: 92.55Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.08CX Basic pKa: ┄CX LogP: 4.82CX LogD: 4.81Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.06
References 1. Ckla P, Tatar E, Kucukguzel I, Sahin F, Yurdakul D, Basu A, Krishnan R, Nichols DB, Kaushik-Basu N, Kucukguzel SG. (2013) Synthesis and characterization of flurbiprofen hydrazide derivatives as potential anti-HCV, anticancer and antimicrobial agents, 22 (12): [10.1007/s00044-013-0550-3 ]