The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 2-(3-(1,3-dioxoisoindolin-2-ylamino)-2-oxo-4-styrylazetidin-1-yl)-3-phenylpropanoate ID: ALA2282138
PubChem CID: 76323555
Max Phase: Preclinical
Molecular Formula: C30H27N3O5
Molecular Weight: 509.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C(Cc1ccccc1)N1C(=O)C(NN2C(=O)c3ccccc3C2=O)C1/C=C/c1ccccc1
Standard InChI: InChI=1S/C30H27N3O5/c1-2-38-30(37)25(19-21-13-7-4-8-14-21)32-24(18-17-20-11-5-3-6-12-20)26(29(32)36)31-33-27(34)22-15-9-10-16-23(22)28(33)35/h3-18,24-26,31H,2,19H2,1H3/b18-17+
Standard InChI Key: LIGSDZPLMXWIHO-ISLYRVAYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
4.0053 -2.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2526 -1.3884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2214 -2.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2335 -3.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0245 -3.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 -4.2911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5236 -3.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8039 -3.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7941 -2.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 -2.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4984 -2.8370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3233 -2.8266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9047 -3.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9040 -4.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7290 -4.2374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7290 -3.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3126 -2.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1094 -3.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6931 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4881 -2.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0714 -2.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8584 -1.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0568 -1.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4769 -1.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3205 -4.8206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3124 -4.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0989 -5.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1092 -4.6072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6927 -5.1906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3228 -3.8103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4895 -4.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0729 -5.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6822 -6.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4670 -6.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0496 -7.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8474 -7.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0594 -6.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4754 -5.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
4 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
3 10 2 0
1 11 1 0
5 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 13 1 0
13 12 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
14 25 2 0
15 26 1 0
26 27 1 0
26 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
27 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.56Molecular Weight (Monoisotopic): 509.1951AlogP: 3.25#Rotatable Bonds: 9Polar Surface Area: 96.02Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.09CX LogP: 4.38CX LogD: 4.38Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.24
References 1. Jarrahpour A, Sheikh J, El-Mounsi I, Mouhoub R, Hadda TB. (2013) Computational evaluation and experimental verification of antibacterial activity of some -lactams: advantages and limitations, 22 (3): [10.1007/s00044-012-0126-7 ]