The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{2,4-Dimethoxy-5-[3-(3,4-dimethoxyphenyl)-2-propenoyl]phenyl}-3-(3,4-dimethoxyphenyl)-2-propen-1-one ID: ALA2282413
PubChem CID: 76316235
Max Phase: Preclinical
Molecular Formula: C30H30O8
Molecular Weight: 518.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C(=O)c2cc(C(=O)/C=C/c3ccc(OC)c(OC)c3)c(OC)cc2OC)cc1OC
Standard InChI: InChI=1S/C30H30O8/c1-33-25-13-9-19(15-29(25)37-5)7-11-23(31)21-17-22(28(36-4)18-27(21)35-3)24(32)12-8-20-10-14-26(34-2)30(16-20)38-6/h7-18H,1-6H3/b11-7+,12-8+
Standard InChI Key: ZEALIXUZVXSYRI-MKICQXMISA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
36.4090 -21.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4078 -22.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1159 -22.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8256 -22.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8227 -21.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1141 -21.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7012 -21.3049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5289 -21.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6998 -22.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9924 -22.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6992 -23.7581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9931 -21.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2857 -21.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5339 -22.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5352 -23.7571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2410 -22.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2397 -21.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9468 -21.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6527 -21.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3593 -21.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3585 -20.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6451 -20.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9415 -20.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2858 -20.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5792 -20.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8702 -20.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8722 -21.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5793 -21.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1623 -20.0785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4548 -20.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0650 -20.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.0626 -19.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7010 -20.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5258 -20.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1656 -21.7187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4568 -21.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0675 -21.7106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.0683 -22.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
5 8 1 0
2 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
4 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
13 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 13 1 0
26 29 1 0
29 30 1 0
21 31 1 0
31 32 1 0
7 33 1 0
8 34 1 0
27 35 1 0
35 36 1 0
20 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.56Molecular Weight (Monoisotopic): 518.1941AlogP: 5.53#Rotatable Bonds: 12Polar Surface Area: 89.52Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.86CX LogD: 4.86Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: 0.09
References 1. Husain A, Ahmad A, Mkhalid IAI, Mishra R, Rashid M. (2013) Synthesis and antimicrobial activity of bischalcone derivatives, 22 (4): [10.1007/s00044-012-0137-4 ]