The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{2,4-Dimethoxy-5-[3-(3,4,5-trimethoxyphenyl)-2-propenoyl]phenyl}-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one ID: ALA2282415
PubChem CID: 76309029
Max Phase: Preclinical
Molecular Formula: C32H34O10
Molecular Weight: 578.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1C(=O)/C=C/c1cc(OC)c(OC)c(OC)c1
Standard InChI: InChI=1S/C32H34O10/c1-35-25-18-26(36-2)22(24(34)12-10-20-15-29(39-5)32(42-8)30(16-20)40-6)17-21(25)23(33)11-9-19-13-27(37-3)31(41-7)28(14-19)38-4/h9-18H,1-8H3/b11-9+,12-10+
Standard InChI Key: UFCOFVQQQJBZLJ-WGDLNXRISA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
14.2870 -28.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2859 -28.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9939 -29.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7036 -28.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7008 -28.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9922 -27.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5792 -27.6773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4069 -27.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5779 -29.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8705 -28.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5772 -30.1305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8711 -28.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1637 -27.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4120 -29.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4132 -30.1295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1190 -28.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1177 -28.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8248 -27.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5308 -28.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2374 -27.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2365 -26.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5232 -26.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8195 -26.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1638 -26.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4573 -26.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7483 -26.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7502 -27.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4574 -28.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0403 -26.4510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3329 -26.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9430 -26.4465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9407 -25.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5790 -26.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4039 -26.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0437 -28.0912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3348 -27.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9455 -28.0830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9464 -28.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4583 -25.6339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1666 -25.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5190 -25.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2246 -25.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
5 8 1 0
2 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
4 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
13 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 13 1 0
26 29 1 0
29 30 1 0
21 31 1 0
31 32 1 0
7 33 1 0
8 34 1 0
27 35 1 0
35 36 1 0
20 37 1 0
37 38 1 0
25 39 1 0
39 40 1 0
22 41 1 0
41 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.61Molecular Weight (Monoisotopic): 578.2152AlogP: 5.55#Rotatable Bonds: 14Polar Surface Area: 107.98Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.55CX LogD: 4.55Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: 0.16
References 1. Husain A, Ahmad A, Mkhalid IAI, Mishra R, Rashid M. (2013) Synthesis and antimicrobial activity of bischalcone derivatives, 22 (4): [10.1007/s00044-012-0137-4 ]