The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-Diacetyl-1,3-di(2-nitrophenylcarbonyloxy)benzene ID: ALA2282417
PubChem CID: 76323582
Max Phase: Preclinical
Molecular Formula: C24H16N2O10
Molecular Weight: 492.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cc(C(C)=O)c(OC(=O)c2ccccc2[N+](=O)[O-])cc1OC(=O)c1ccccc1[N+](=O)[O-]
Standard InChI: InChI=1S/C24H16N2O10/c1-13(27)17-11-18(14(2)28)22(36-24(30)16-8-4-6-10-20(16)26(33)34)12-21(17)35-23(29)15-7-3-5-9-19(15)25(31)32/h3-12H,1-2H3
Standard InChI Key: HGVJJJNQJAKJNI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
4.1258 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1247 -5.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8327 -5.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5424 -5.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5395 -4.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8309 -3.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4180 -3.8426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4178 -3.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7100 -2.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1254 -2.6166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2457 -3.8361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2426 -3.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9488 -2.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5334 -2.6130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6569 -3.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3626 -2.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3599 -1.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6457 -1.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9429 -1.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7151 -1.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0081 -1.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 -1.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3024 -2.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0099 -3.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4166 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7092 -5.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4160 -6.2958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2507 -5.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2520 -6.2947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9578 -5.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0132 -3.8398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7218 -4.2469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3064 -4.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6569 -3.8391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3647 -4.2475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9493 -4.2479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
5 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 13 1 0
9 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 9 1 0
2 25 1 0
25 26 1 0
25 27 2 0
4 28 1 0
28 29 2 0
28 30 1 0
31 32 2 0
31 33 1 0
24 31 1 0
34 35 2 0
34 36 1 0
15 34 1 0
M CHG 4 31 1 33 -1 34 1 36 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.40Molecular Weight (Monoisotopic): 492.0805AlogP: 4.35#Rotatable Bonds: 8Polar Surface Area: 173.02Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.14Np Likeness Score: -0.49
References 1. Husain A, Ahmad A, Mkhalid IAI, Mishra R, Rashid M. (2013) Synthesis and antimicrobial activity of bischalcone derivatives, 22 (4): [10.1007/s00044-012-0137-4 ]