The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-Diacetyl-1,3-di(3-chlorophenylcarbonyloxy)benzene ID: ALA2282420
PubChem CID: 76309031
Max Phase: Preclinical
Molecular Formula: C24H16Cl2O6
Molecular Weight: 471.29
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cc(C(C)=O)c(OC(=O)c2cccc(Cl)c2)cc1OC(=O)c1cccc(Cl)c1
Standard InChI: InChI=1S/C24H16Cl2O6/c1-13(27)19-11-20(14(2)28)22(32-24(30)16-6-4-8-18(26)10-16)12-21(19)31-23(29)15-5-3-7-17(25)9-15/h3-12H,1-2H3
Standard InChI Key: NWOCCRQGDXPBTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
34.6343 -4.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6331 -5.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3412 -5.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0508 -5.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0480 -4.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3394 -3.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9265 -3.9416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9263 -3.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2185 -2.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6339 -2.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7542 -3.9352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7511 -3.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4573 -2.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0419 -2.7121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1654 -3.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8710 -2.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8684 -1.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1542 -1.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4514 -1.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2236 -1.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5166 -1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8080 -1.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8108 -2.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5184 -3.1205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9251 -5.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2177 -5.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9245 -6.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7592 -5.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7605 -6.3938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4663 -5.1669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1047 -3.1271 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
39.5801 -3.1140 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
5 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 13 1 0
9 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 9 1 0
2 25 1 0
25 26 1 0
25 27 2 0
4 28 1 0
28 29 2 0
28 30 1 0
23 31 1 0
16 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.29Molecular Weight (Monoisotopic): 470.0324AlogP: 5.84#Rotatable Bonds: 6Polar Surface Area: 86.74Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.62CX LogD: 5.62Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.40
References 1. Husain A, Ahmad A, Mkhalid IAI, Mishra R, Rashid M. (2013) Synthesis and antimicrobial activity of bischalcone derivatives, 22 (4): [10.1007/s00044-012-0137-4 ]