The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Chlorophenyl)-1-{5-[3-(4-chlorophenyl)-2-propenoyl]-2,4-dihydroxyphenyl}-2-propen-1-one ID: ALA2282421
PubChem CID: 14032717
Max Phase: Preclinical
Molecular Formula: C24H16Cl2O4
Molecular Weight: 439.29
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(Cl)cc1)c1cc(C(=O)/C=C/c2ccc(Cl)cc2)c(O)cc1O
Standard InChI: InChI=1S/C24H16Cl2O4/c25-17-7-1-15(2-8-17)5-11-21(27)19-13-20(24(30)14-23(19)29)22(28)12-6-16-3-9-18(26)10-4-16/h1-14,29-30H/b11-5+,12-6+
Standard InChI Key: BLDGKMNEEVXTHU-YDWXAUTNSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.9648 -3.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9637 -4.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6717 -4.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3814 -4.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3786 -3.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6700 -2.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2570 -2.8768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0847 -2.8704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2557 -4.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5483 -4.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2550 -5.3300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5489 -3.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8415 -2.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0898 -4.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0910 -5.3290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7968 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7955 -3.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5026 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2086 -3.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9152 -2.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9143 -2.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2010 -1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4973 -2.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8416 -2.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1351 -1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4261 -2.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4281 -2.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1352 -3.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2819 -1.6505 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.6208 -1.6459 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
5 8 1 0
2 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
4 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
13 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 13 1 0
26 29 1 0
21 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.29Molecular Weight (Monoisotopic): 438.0426AlogP: 6.20#Rotatable Bonds: 6Polar Surface Area: 74.60Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.36CX Basic pKa: ┄CX LogP: 7.71CX LogD: 5.10Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: 0.11
References 1. Husain A, Ahmad A, Mkhalid IAI, Mishra R, Rashid M. (2013) Synthesis and antimicrobial activity of bischalcone derivatives, 22 (4): [10.1007/s00044-012-0137-4 ]