The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-benzoylphenyl)-2-hydroxy-3-(4-(2-(5-methyl-2-phenylthiazol-4-yl)ethoxy)phenyl)propanoic acid ID: ALA2282517
PubChem CID: 76309038
Max Phase: Preclinical
Molecular Formula: C34H29NO5S
Molecular Weight: 563.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1sc(-c2ccccc2)nc1CCOc1ccc(C[C@@](O)(C(=O)O)c2ccccc2C(=O)c2ccccc2)cc1
Standard InChI: InChI=1S/C34H29NO5S/c1-23-30(35-32(41-23)26-12-6-3-7-13-26)20-21-40-27-18-16-24(17-19-27)22-34(39,33(37)38)29-15-9-8-14-28(29)31(36)25-10-4-2-5-11-25/h2-19,39H,20-22H2,1H3,(H,37,38)/t34-/m0/s1
Standard InChI Key: KHTGTWNPDQEAJY-UMSFTDKQSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
24.8782 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8770 -4.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5919 -4.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3083 -4.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3055 -3.5714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5901 -3.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0184 -3.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7361 -3.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1622 -4.8144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4481 -4.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1412 -2.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9661 -2.8380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7213 -2.1364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7333 -4.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0735 -4.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0862 -3.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3057 -3.2239 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.8104 -3.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2848 -4.5584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7611 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9853 -3.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5833 -3.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7590 -3.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3388 -3.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7489 -4.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5719 -4.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7375 -4.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0255 -4.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0282 -5.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7448 -6.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4601 -5.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4538 -4.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5571 -3.5581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1647 -4.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8827 -4.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1576 -3.5518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8882 -5.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6053 -6.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3173 -5.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3074 -4.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5897 -4.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
2 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
11 13 2 0
10 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
16 20 1 0
18 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 27 1 1
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
8 33 1 0
32 34 1 0
34 35 1 0
34 36 2 0
35 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.68Molecular Weight (Monoisotopic): 563.1766AlogP: 6.49#Rotatable Bonds: 11Polar Surface Area: 96.72Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.46CX Basic pKa: 2.75CX LogP: 7.26CX LogD: 4.24Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.18Np Likeness Score: -0.50
References 1. Verma RK, Kumar V, Ghosh P, Wadhwa LK. (2013) 3D-QSAR study of tyrosine and propanoic acid derivatives as PPAR/ dual agonists using CoMSIA, 22 (1): [10.1007/s00044-012-0003-4 ]