The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-hydroxy-2-(2-(methoxycarbonyl)phenyl)-3-(4-(2-(5-methyl-2-phenyloxazol-4-yl)ethoxy)phenyl)propanoic acid ID: ALA2282520
PubChem CID: 76330830
Max Phase: Preclinical
Molecular Formula: C29H27NO7
Molecular Weight: 501.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccccc1[C@@](O)(Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)C(=O)O
Standard InChI: InChI=1S/C29H27NO7/c1-19-25(30-26(37-19)21-8-4-3-5-9-21)16-17-36-22-14-12-20(13-15-22)18-29(34,28(32)33)24-11-7-6-10-23(24)27(31)35-2/h3-15,34H,16-18H2,1-2H3,(H,32,33)/t29-/m0/s1
Standard InChI Key: LDUYGALTOGKKFB-LJAQVGFWSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
7.9606 -15.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9595 -16.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6742 -17.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3907 -16.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3878 -15.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6724 -15.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1007 -15.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8183 -15.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2447 -17.2133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5307 -16.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2233 -15.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0483 -15.2371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8035 -14.5355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8158 -17.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1561 -16.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1688 -15.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3885 -15.6230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8931 -16.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3675 -16.9575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8438 -15.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0682 -16.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6661 -15.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8418 -15.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4217 -16.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8317 -16.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6547 -16.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8197 -16.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1077 -17.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1106 -18.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8271 -18.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5422 -18.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5360 -17.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6393 -15.9572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2469 -16.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9648 -17.1821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2397 -15.9508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9505 -15.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
2 9 1 0
9 10 1 0
8 11 1 1
11 12 1 0
11 13 2 0
10 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
16 20 1 0
18 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
8 33 1 0
32 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.54Molecular Weight (Monoisotopic): 501.1788AlogP: 4.57#Rotatable Bonds: 10Polar Surface Area: 119.09Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.23CX Basic pKa: 0.93CX LogP: 5.04CX LogD: 1.60Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -0.59
References 1. Verma RK, Kumar V, Ghosh P, Wadhwa LK. (2013) 3D-QSAR study of tyrosine and propanoic acid derivatives as PPAR/ dual agonists using CoMSIA, 22 (1): [10.1007/s00044-012-0003-4 ]