The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-aminopentane-2yl)-2,6-dimethoxy-4-methyl-5-(2-(trifluoromethyl)cyclohexyloxy)quinolin-8-amine ID: ALA2282812
PubChem CID: 76309059
Max Phase: Preclinical
Molecular Formula: C24H34F3N3O3
Molecular Weight: 469.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C)c2c(OC3CCCCC3C(F)(F)F)c(OC)cc(NC(C)CCCN)c2n1
Standard InChI: InChI=1S/C24H34F3N3O3/c1-14-12-20(32-4)30-22-17(29-15(2)8-7-11-28)13-19(31-3)23(21(14)22)33-18-10-6-5-9-16(18)24(25,26)27/h12-13,15-16,18,29H,5-11,28H2,1-4H3
Standard InChI Key: DANVDBHAJGECBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
30.9104 -4.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6184 -4.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6166 -3.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3253 -3.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3260 -4.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0346 -4.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7428 -4.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7381 -3.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0290 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6120 -2.4464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9100 -2.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9236 -1.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2257 -0.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5100 -1.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4968 -2.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8899 -3.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1830 -3.2553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1846 -2.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4745 -3.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6380 -0.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3388 -1.2353 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.6514 0.0062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.4235 -0.5984 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.0246 -2.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4521 -4.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4553 -5.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6203 -5.7271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9136 -6.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9154 -6.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2049 -5.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4981 -6.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7895 -5.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0827 -6.1439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16 1 2 0
1 2 1 0
2 5 2 0
4 3 2 0
3 16 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
3 10 1 0
10 11 1 0
11 12 1 0
11 18 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 18 1 0
16 17 1 0
17 19 1 0
12 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
9 24 1 0
7 25 1 0
25 26 1 0
2 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.55Molecular Weight (Monoisotopic): 469.2552AlogP: 5.60#Rotatable Bonds: 9Polar Surface Area: 78.63Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 4.73CX LogD: 2.07Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.17
References 1. Kiani YS, Kalsoom S, Riaz N. (2013) In silico ligand-based pharmacophore model generation for the identification of novel Pneumocystis carinii DHFR inhibitors, 22 (2): [10.1007/s00044-012-0082-2 ]