(E)-N-{3-[4-(2-oxo-2-(pyrrolidin-1-yl)ethyl)phenyl]allyl}-1H-pyrrolo[3,4-b]quinolin-3(2H)-one

ID: ALA2283034

PubChem CID: 76334462

Max Phase: Preclinical

Molecular Formula: C26H25N3O2

Molecular Weight: 411.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(/C=C/CN2Cc3cc4ccccc4nc3C2=O)cc1)N1CCCC1

Standard InChI:  InChI=1S/C26H25N3O2/c30-24(28-13-3-4-14-28)16-20-11-9-19(10-12-20)6-5-15-29-18-22-17-21-7-1-2-8-23(21)27-25(22)26(29)31/h1-2,5-12,17H,3-4,13-16,18H2/b6-5+

Standard InChI Key:  KSTLYYKGFUEUHO-AATRIKPKSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -0.1348  -17.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1336  -18.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5775  -19.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5757  -17.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2844  -17.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2851  -18.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9937  -19.0851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9881  -17.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6972  -17.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7003  -18.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4846  -18.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9663  -18.2592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4796  -17.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7400  -19.7037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7835  -18.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1948  -18.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0120  -18.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4232  -19.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0149  -20.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4255  -21.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2435  -21.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6493  -20.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2363  -19.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6558  -21.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4730  -21.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8779  -21.0653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8852  -22.4807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5602  -23.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1703  -23.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8759  -23.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7018  -22.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 11 14  2  0
 12 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
M  END

Associated Targets(Human)

SK-N-SH (1499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.51Molecular Weight (Monoisotopic): 411.1947AlogP: 4.07#Rotatable Bonds: 5
Polar Surface Area: 53.51Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 12.73CX Basic pKa: 1.23CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -0.52

References

1. Nagarapua L, Gaikwad HK, Manikonda SR, Bantu R, Manda KM, Kalivendi SV.  (2013)  Synthesis of novel building blocks of 1H-pyrrolo[3,4-b]quinolin-3(2H)-one and evaluation of their antitumor activity,  22  (1): [10.1007/s00044-012-0018-x]

Source