The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3beta-Hydroxy-olean-12-en-28-prenylate ID: ALA2283547
PubChem CID: 76309110
Max Phase: Preclinical
Molecular Formula: C35H56O3
Molecular Weight: 524.83
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCOC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@H](O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2
Standard InChI: InChI=1S/C35H56O3/c1-23(2)14-21-38-29(37)35-19-17-30(3,4)22-25(35)24-10-11-27-32(7)15-13-28(36)31(5,6)26(32)12-16-34(27,9)33(24,8)18-20-35/h10,14,25-28,36H,11-13,15-22H2,1-9H3/t25-,26-,27+,28-,32-,33+,34+,35-/m0/s1
Standard InChI Key: KLGMAXQIMCVYAF-PUZPAKLESA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
5.8524 -5.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8565 -4.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1467 -6.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7351 -6.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2680 -4.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5623 -4.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4409 -5.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7351 -6.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0294 -7.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1508 -4.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9738 -5.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5582 -6.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1384 -6.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4326 -4.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2680 -5.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0335 -5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4409 -7.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9738 -4.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5623 -3.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3236 -6.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2763 -3.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9697 -6.0918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3236 -6.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9821 -3.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8442 -6.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6796 -4.8619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1384 -5.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7269 -5.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4256 -8.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6084 -8.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6096 -7.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8595 -2.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6766 -2.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3878 -5.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0950 -4.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8032 -5.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5104 -4.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8042 -6.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 7 1 0
5 15 1 0
6 2 1 0
7 3 1 0
8 17 1 1
9 8 1 0
10 2 2 0
5 11 1 1
12 1 1 0
13 3 1 0
7 14 1 1
15 12 1 0
16 4 1 0
17 13 1 0
18 5 1 0
6 19 1 6
20 9 1 0
21 19 1 0
22 11 2 0
23 16 1 0
24 18 1 0
1 25 1 6
26 11 1 0
3 27 1 1
4 28 1 1
29 9 1 0
30 9 1 0
20 31 1 1
32 21 1 0
33 21 1 0
5 6 1 0
14 10 1 0
8 4 1 0
21 24 1 0
20 23 1 0
26 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.83Molecular Weight (Monoisotopic): 524.4229AlogP: 8.66#Rotatable Bonds: 3Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.10CX LogD: 8.10Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: 3.15
References 1. Mallavadhani UV, Mahapatra A, Pattnaik B, Vanga N, Suri N, Saxena AK. (2013) Synthesis and anti-cancer activity of some novel C-17 analogs of ursolic and oleanolic acids, 22 (3): [10.1007/s00044-012-0106-y ]