3-cyclopropyl-5-((2'-(N-phenylsulfamoyl)biphenyl-4-yl)methyl)-1-propyl-1H-pyrazole-4-carboxamide

ID: ALA2283575

PubChem CID: 76320045

Max Phase: Preclinical

Molecular Formula: C29H30N4O3S

Molecular Weight: 514.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCn1nc(C2CC2)c(C(N)=O)c1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2ccccc2)cc1

Standard InChI:  InChI=1S/C29H30N4O3S/c1-2-18-33-25(27(29(30)34)28(31-33)22-16-17-22)19-20-12-14-21(15-13-20)24-10-6-7-11-26(24)37(35,36)32-23-8-4-3-5-9-23/h3-15,22,32H,2,16-19H2,1H3,(H2,30,34)

Standard InChI Key:  WCEPCZCCNOFLMS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    4.0268  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0256  -25.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7337  -26.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4433  -25.8053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4405  -24.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7319  -24.5773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1482  -26.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1481  -27.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8556  -27.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5637  -27.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5597  -26.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8517  -25.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3190  -24.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3188  -23.7606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9856  -23.2813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7329  -22.5042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9156  -22.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6634  -23.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8824  -23.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2758  -22.9873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7116  -24.3340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7621  -23.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3708  -22.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2028  -22.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8481  -24.9856    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5541  -24.5740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0546  -25.1926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2651  -24.4002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2635  -24.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2635  -25.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9721  -26.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6790  -25.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6729  -24.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9637  -24.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4351  -21.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3475  -21.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6866  -21.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  2  0
 19 20  1  0
 19 21  2  0
 18 19  1  0
 15 22  1  0
 22 23  1  0
 23 24  1  0
 12 25  1  0
 25 26  1  0
 25 27  2  0
 25 28  2  0
 26 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 17 35  1  0
 36 35  1  0
 37 36  1  0
 35 37  1  0
M  END

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 514.65Molecular Weight (Monoisotopic): 514.2039AlogP: 5.33#Rotatable Bonds: 10
Polar Surface Area: 107.08Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.61CX Basic pKa: 2.21CX LogP: 5.03CX LogD: 4.85
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.13

References

1. Sharma MC, Kohli DV.  (2013)  Comprehensive structureactivity relationship analysis of substituted 5-(biphenyl-4-ylmethyl) pyrazoles derivatives as AT1 selective angiotensin II receptor antagonists: 2D and kNNMFA QSAR approach,  22  (5): [10.1007/s00044-012-0206-8]

Source