4-chloro-1,3-dimethyl-N-(4-(4-(trifluoromethyl)phenoxy)benzyl)-1H-pyrazole-5-carboxamide

ID: ALA2285713

PubChem CID: 15008417

Max Phase: Preclinical

Molecular Formula: C20H17ClF3N3O2

Molecular Weight: 423.82

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(C)c(C(=O)NCc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)c1Cl

Standard InChI:  InChI=1S/C20H17ClF3N3O2/c1-12-17(21)18(27(2)26-12)19(28)25-11-13-3-7-15(8-4-13)29-16-9-5-14(6-10-16)20(22,23)24/h3-10H,11H2,1-2H3,(H,25,28)

Standard InChI Key:  HBLSFQVCUIUPNU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    0.5121  -21.9243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1483  -22.4344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8301  -21.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6153  -21.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8007  -21.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1095  -23.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1265  -20.5627    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5430  -22.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5540  -23.2035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2452  -21.9684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9583  -22.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6605  -21.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3697  -22.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0714  -21.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0609  -21.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3428  -20.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6440  -21.1366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7625  -20.6969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4762  -21.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4837  -21.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1965  -22.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8991  -21.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8844  -21.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1711  -20.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6132  -22.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6263  -23.1059    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.3143  -21.8689    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.3181  -22.6956    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.3524  -20.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
  5 29  1  0
M  END

Associated Targets(non-human)

Nephotettix cincticeps (805 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.82Molecular Weight (Monoisotopic): 423.0961AlogP: 5.12#Rotatable Bonds: 5
Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.16CX Basic pKa: 1.42CX LogP: 4.23CX LogD: 4.23
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.62Np Likeness Score: -1.60

References

1. OKADA I, OKUI S, WADA M, TAKAHASHI Y.  (1996)  Synthesis and Insecticidal Activity of N-(4-Aryloxybenzyl)-pyrazolecarboxamide Derivatives,  21  (3): [10.1584/jpestics.21.305]

Source