The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(3'-Hydroxy-4'-methoxyphenyl)-2-(3,4,5-Trimethoxyphenyl)prop-2-en-1-ol ID: ALA2285720
PubChem CID: 11078510
Max Phase: Preclinical
Molecular Formula: C19H22O6
Molecular Weight: 346.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C(/CO)c2cc(OC)c(OC)c(OC)c2)cc1O
Standard InChI: InChI=1S/C19H22O6/c1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3/h5-10,20-21H,11H2,1-4H3/b14-7-
Standard InChI Key: BZHARLORUKYJME-AUWJEWJLSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
25.2505 -5.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0656 -5.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8645 -4.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9466 -5.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5493 -3.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3692 -3.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1175 -4.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4974 -4.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3033 -4.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5149 -5.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5676 -4.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7525 -4.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6998 -5.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8118 -6.3226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4468 -6.3823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0481 -4.8703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7617 -5.0861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3164 -5.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9017 -6.4759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9976 -6.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0151 -7.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6691 -4.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7168 -6.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1672 -2.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6018 -2.1393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 11 1 0
5 7 1 0
6 5 2 0
7 9 1 0
8 2 1 0
9 3 2 0
10 13 1 0
11 12 2 0
12 6 1 0
13 18 2 0
14 1 1 0
15 2 1 0
16 3 1 0
17 4 1 0
18 12 1 0
19 10 1 0
20 14 1 0
21 15 1 0
22 16 1 0
23 19 1 0
8 7 2 0
10 4 2 0
5 24 1 0
24 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 346.38Molecular Weight (Monoisotopic): 346.1416AlogP: 2.96#Rotatable Bonds: 7Polar Surface Area: 77.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.83CX Basic pKa: ┄CX LogP: 2.40CX LogD: 2.40Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.75Np Likeness Score: 0.69
References 1. Liu Y, Li X, Zhao C, Lu Y, Li W, Liu Z, Feng G, Yang L. (2013) Synthesis and insect antifeedant activity of stilbene derivatives against Brontispa longissima Larvae, 22 (5): [10.1007/s00044-012-0212-x ]