3,7-dimethyloct-6-enyl 3-(4-chlorophenyl)acrylate

ID: ALA2285944

PubChem CID: 76312832

Max Phase: Preclinical

Molecular Formula: C19H25ClO2

Molecular Weight: 320.86

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCCC(C)CCOC(=O)/C=C/c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C19H25ClO2/c1-15(2)5-4-6-16(3)13-14-22-19(21)12-9-17-7-10-18(20)11-8-17/h5,7-12,16H,4,6,13-14H2,1-3H3/b12-9+

Standard InChI Key:  JPGHYEGPCRCEHW-FMIVXFBMSA-N

Molfile:  

     RDKit          2D

 22 22  0  0  0  0  0  0  0  0999 V2000
   25.5397  -12.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2305  -11.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9540  -12.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9866  -13.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6448  -11.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3683  -12.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4009  -13.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1243  -13.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1570  -14.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8152  -13.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8162  -11.9836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5687  -11.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5675  -11.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2756  -12.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9853  -11.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9824  -11.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2738  -10.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6936  -12.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4007  -11.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1090  -12.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1103  -13.2098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8609  -10.7598    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
  1 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 11  1  0
 20 21  2  0
 12 22  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Brassica rapa subsp. chinensis (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Athelia rolfsii (768 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pythium (470 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 320.86Molecular Weight (Monoisotopic): 320.1543AlogP: 5.67#Rotatable Bonds: 8
Polar Surface Area: 26.30Molecular Species: HBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.39CX LogD: 6.39
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.35Np Likeness Score: 0.90

References

1. ZHU J, ZHU H, KOBAMOTO N, YASUDA M, TAWATA S.  (2000)  Fungitoxic and Phytotoxic Activities of Cinnamic Acid Esters and Amides,  25  (3): [10.1584/jpestics.25.263]

Source