The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-((methoxyimino)(1-methyl-1H-imidazol-2-yl)methyl)benzaldehyde O-1-(3-(trifluoromethyl)phenyl)ethyl oxime ID: ALA2286151
PubChem CID: 76309136
Max Phase: Preclinical
Molecular Formula: C22H21F3N4O2
Molecular Weight: 430.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(\c1ccccc1/C=N/OC(C)c1cccc(C(F)(F)F)c1)c1nccn1C
Standard InChI: InChI=1S/C22H21F3N4O2/c1-15(16-8-6-9-18(13-16)22(23,24)25)31-27-14-17-7-4-5-10-19(17)20(28-30-3)21-26-11-12-29(21)2/h4-15H,1-3H3/b27-14+,28-20+
Standard InChI Key: FGODETMFEHELKH-VSICBDRASA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
17.2710 -6.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2699 -7.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9779 -7.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6876 -7.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6848 -6.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9761 -5.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3909 -5.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0605 -6.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3878 -5.1073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6786 -4.7014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6755 -3.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0770 -7.2075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8595 -7.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3273 -6.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8323 -6.1234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4252 -7.7004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9737 -5.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2648 -4.7069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2623 -3.8897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5534 -3.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5510 -2.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8469 -3.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1414 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4353 -3.8933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4373 -4.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1512 -5.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8543 -4.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7266 -3.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7246 -2.6693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.0199 -3.8968 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.0132 -3.0748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
10 11 1 0
12 13 1 0
8 12 1 0
13 14 2 0
14 15 1 0
15 8 2 0
12 16 1 0
6 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
24 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.43Molecular Weight (Monoisotopic): 430.1617AlogP: 4.95#Rotatable Bonds: 7Polar Surface Area: 61.00Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.62CX LogP: 5.42CX LogD: 5.42Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: -1.30
References 1. KAI H, NAKAI T, TOMIDA M, KUMANO K, ICHIBA T. (2001) Synthesis and Fungicidal Activities of 2-(-Methoxyiminobenzyl)-1-methylimidazole Derivatives, 26 (2): [10.1584/jpestics.26.169 ]