O-ethyl S-isopropyl 2-oxooxazolidin-3-ylphosphonothioate

ID: ALA2286305

PubChem CID: 76323722

Max Phase: Preclinical

Molecular Formula: C8H16NO4PS

Molecular Weight: 253.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOP(=O)(SC(C)C)N1CCOC1=O

Standard InChI:  InChI=1S/C8H16NO4PS/c1-4-13-14(11,15-7(2)3)9-5-6-12-8(9)10/h7H,4-6H2,1-3H3

Standard InChI Key:  YMEDTTDSJBHIIH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 15 15  0  0  0  0  0  0  0  0999 V2000
    5.3530  -16.0549    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.9308  -16.6327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6811  -16.5251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7711  -15.4730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7804  -15.3550    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.8909  -17.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9089  -16.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4142  -16.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8861  -17.5879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6705  -17.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3250  -17.8348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5973  -15.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0232  -14.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5778  -17.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9884  -16.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  1  5  1  0
  2  6  1  0
  7  8  1  0
  3  7  1  0
  8  9  1  0
  9 10  1  0
 10  3  1  0
 10 11  2  0
  5 12  1  0
 12 13  1  0
  6 14  1  0
 12 15  1  0
M  END

Associated Targets(non-human)

Meloidogyne incognita (862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Myzus persicae (1112 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tetranychus urticae (2600 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 253.26Molecular Weight (Monoisotopic): 253.0538AlogP: 2.72#Rotatable Bonds: 5
Polar Surface Area: 55.84Molecular Species: HBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.42CX LogD: 1.42
Aromatic Rings: Heavy Atoms: 15QED Weighted: 0.70Np Likeness Score: -0.45

References

1. KOYANAGI T, OKADA H, IMAI O, TOKI T, HAGA T.  (1997)  Synthesis and Pesticidal Activities of N-Phosphinoyl Heterocycles,  22  (3): [10.1584/jpestics.22.187]

Source