(R,R)(+)-2-(4-(5-chloro-3-fluoropyridin-2-yloxy)phenoxy)propionic acid 4-(1-ethoxycarbonyl-ethoxy)-phenyl ester

ID: ALA2286490

PubChem CID: 76316395

Max Phase: Preclinical

Molecular Formula: C25H23ClFNO7

Molecular Weight: 503.91

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@@H](C)Oc1ccc(OC(=O)[C@@H](C)Oc2ccc(Oc3ncc(Cl)cc3F)cc2)cc1

Standard InChI:  InChI=1S/C25H23ClFNO7/c1-4-31-24(29)15(2)32-18-7-11-21(12-8-18)35-25(30)16(3)33-19-5-9-20(10-6-19)34-23-22(27)13-17(26)14-28-23/h5-16H,4H2,1-3H3/t15-,16-/m1/s1

Standard InChI Key:  IWNZCKQEOQZUEL-HZPDHXFCSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   25.1775   -9.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1787   -8.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4638   -8.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7474   -8.4485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7502   -9.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4656   -9.6882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8935   -8.0361    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.4682  -10.5133    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.0373   -9.6943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3213   -9.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3215   -8.4618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6063   -8.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8924   -8.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8981   -9.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6139   -9.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1758   -8.0584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4634   -8.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7468   -8.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4676   -9.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7551   -9.7158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1841   -9.7085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0386   -9.3069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0369   -8.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3211   -8.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6077   -8.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6146   -9.3193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3309   -9.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8906   -8.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1787   -8.4992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4616   -8.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1841   -9.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4722   -9.7413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9012   -9.7321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7551   -9.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0432   -9.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  1
 17 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  1
 29 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 34 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2286490

   ethyl (2R)-2-[4-[(2R)-2-[4-(5-chloro-3-fluoropyridin-2-yl)oxyphenoxy]propanoyl]oxyphenoxy]propanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 503.91

Molecular Weight (Monoisotopic): 503.1147

AlogP: 5.37

#Rotatable Bonds: 10

Polar Surface Area: 93.18

Molecular Species: NEUTRAL

HBA: 8

HBD: ┄

#RO5 Violations: 2

HBA (Lipinski): 8

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.68

CX LogD: 5.68

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.27

Np Likeness Score: -1.12

References

1. Tajik H, Dadras A, Aghabeygi S.  (2011)  A facile synthesis of novel optically active R,R-2-(4-(2-(4-(5-chloro-3-halo-pyridin-2-yloxy)-phenoxy)-propionyloxy)-phenoxy)-propionic acid esters using cyanuric chloride as potential herbicide,  22  (5): [10.1016/j.cclet.2010.12.001]

Source

Source(1):

• Scientific Literature