The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N',N-(3,3'-(3,3'-oxybis(propane-3,1-diyl))bis(1-((6-chloropyridin-3-yl)methyl)imidazolidin-3-yl-2-ylidene))dinitramide ID: ALA2286696
PubChem CID: 76309178
Max Phase: Preclinical
Molecular Formula: C24H30Cl2N10O5
Molecular Weight: 609.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])/N=C1/N(CCCOCCCN2CCN(Cc3ccc(Cl)nc3)/C2=N/[N+](=O)[O-])CCN1Cc1ccc(Cl)nc1
Standard InChI: InChI=1S/C24H30Cl2N10O5/c25-21-5-3-19(15-27-21)17-33-11-9-31(23(33)29-35(37)38)7-1-13-41-14-2-8-32-10-12-34(24(32)30-36(39)40)18-20-4-6-22(26)28-16-20/h3-6,15-16H,1-2,7-14,17-18H2/b29-23-,30-24+
Standard InChI Key: AAWRCBWYNSEVTD-UEUMJKGWSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
9.6956 -19.4212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6974 -20.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4754 -20.4951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9551 -19.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4718 -19.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0368 -20.7238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7238 -21.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5397 -21.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9106 -22.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7260 -22.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1694 -21.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7915 -20.6611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9772 -20.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9857 -21.4291 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.1488 -19.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7343 -19.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7540 -17.1005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5694 -17.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9763 -16.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5690 -15.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7504 -15.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3472 -16.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7935 -16.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2862 -17.0496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0510 -17.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7214 -18.2996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3739 -17.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1046 -17.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2790 -18.0985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1249 -18.9010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -19.4382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3516 -19.1713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5300 -16.4014 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4483 -19.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8655 -19.4847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5638 -19.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2805 -19.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9789 -19.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1232 -21.5364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8720 -21.8693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4645 -22.0189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
1 2 1 0
3 4 1 0
4 5 1 0
5 1 1 0
2 6 2 0
3 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
23 24 1 0
25 26 1 0
24 25 1 0
26 27 1 0
27 28 1 0
28 24 1 0
25 29 2 0
29 30 1 0
30 31 2 0
30 32 1 0
22 33 1 0
26 16 1 0
16 34 1 0
34 15 1 0
15 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 1 1 0
6 39 1 0
39 40 2 0
39 41 1 0
M CHG 4 30 1 32 -1 39 1 41 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 609.48Molecular Weight (Monoisotopic): 608.1778AlogP: 2.61#Rotatable Bonds: 14Polar Surface Area: 158.97Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 15HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.12CX LogP: 1.49CX LogD: 1.49Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.13Np Likeness Score: -0.71
References 1. KAGABU S, IWAYA K, KONISHI H, SAKAI A, ITAZU Y, KIRIYAMA K, NISHIMURA K. (2002) Synthesis of Alkylene-Tethered Bis-Imidacloprid Derivatives as Highly Insecticidal and Nerve-Exciting Agents with Potent Affinity to [3H] Imidacloprid-Binding Sites on Nicotinic Acetylcholine Receptor, 27 (3): [10.1584/jpestics.27.249 ]