The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(3,3'-(nonane-1,9-diyl)bis(1-((6-chloropyridin-3-yl)methyl)imidazolidin-3-yl-2-ylidene))dinitramide ID: ALA2286699
PubChem CID: 20770753
Max Phase: Preclinical
Molecular Formula: C27H36Cl2N10O4
Molecular Weight: 635.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])/N=C1/N(CCCCCCCCCN2CCN(Cc3ccc(Cl)nc3)/C2=N/[N+](=O)[O-])CCN1Cc1ccc(Cl)nc1
Standard InChI: InChI=1S/C27H36Cl2N10O4/c28-24-10-8-22(18-30-24)20-36-16-14-34(26(36)32-38(40)41)12-6-4-2-1-3-5-7-13-35-15-17-37(27(35)33-39(42)43)21-23-9-11-25(29)31-19-23/h8-11,18-19H,1-7,12-17,20-21H2/b32-26-,33-27+
Standard InChI Key: MBPRFODQNKJUMW-YUGUBMJKSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
13.9672 -27.3851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2122 -28.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0366 -28.1848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3009 -27.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6388 -26.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7189 -28.8371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0451 -29.5949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8666 -29.6946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5541 -30.2594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4610 -28.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2859 -28.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7082 -29.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5323 -29.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9335 -28.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5046 -28.1406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6819 -28.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7584 -28.8354 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.5684 -19.9757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3912 -19.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7802 -19.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3474 -18.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5215 -18.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1363 -19.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3118 -19.3079 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.6049 -19.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0815 -19.8768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8133 -20.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4748 -21.1544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1482 -20.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9028 -19.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0253 -20.9053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8426 -21.7099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4468 -22.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0533 -21.9577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4646 -21.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1739 -22.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1637 -23.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8731 -23.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8629 -24.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5722 -24.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5620 -25.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2714 -26.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2612 -26.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
2 6 2 0
6 7 1 0
7 8 2 0
7 9 1 0
3 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
27 31 2 0
31 32 1 0
32 33 2 0
32 34 1 0
28 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 1 1 0
M CHG 4 7 1 9 -1 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.56Molecular Weight (Monoisotopic): 634.2298AlogP: 4.54#Rotatable Bonds: 16Polar Surface Area: 149.74Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.21CX LogP: 4.22CX LogD: 4.22Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -0.57
References 1. KAGABU S, IWAYA K, KONISHI H, SAKAI A, ITAZU Y, KIRIYAMA K, NISHIMURA K. (2002) Synthesis of Alkylene-Tethered Bis-Imidacloprid Derivatives as Highly Insecticidal and Nerve-Exciting Agents with Potent Affinity to [3H] Imidacloprid-Binding Sites on Nicotinic Acetylcholine Receptor, 27 (3): [10.1584/jpestics.27.249 ] 2. Kagabu S. (2008) Pharmacophore of neonicotinoid insecticides, 33 (1): [10.1584/jpestics.R07-05 ]