The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-carboxynonane-3,4-diaminium chloride ID: ALA2286780
PubChem CID: 76320106
Max Phase: Preclinical
Molecular Formula: C10H24Cl2N2O2
Molecular Weight: 202.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(N)C(N)CCCCCC(=O)O.Cl.Cl
Standard InChI: InChI=1S/C10H22N2O2.2ClH/c1-2-8(11)9(12)6-4-3-5-7-10(13)14;;/h8-9H,2-7,11-12H2,1H3,(H,13,14);2*1H
Standard InChI Key: RNVQNZAXGQDXIX-UHFFFAOYSA-N
Molfile:
RDKit 2D
16 13 0 0 0 0 0 0 0 0999 V2000
11.2554 -14.9384 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.8939 -17.9849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8791 -17.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6136 -16.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3088 -17.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0412 -16.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7363 -17.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4687 -16.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1638 -17.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8961 -16.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5913 -17.4278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9334 -16.1592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6509 -15.9658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1728 -16.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1888 -15.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4598 -18.4741 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
4 13 1 0
3 14 1 0
14 15 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 202.30Molecular Weight (Monoisotopic): 202.1681AlogP: 1.09#Rotatable Bonds: 8Polar Surface Area: 89.34Molecular Species: ZWITTERIONHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.50CX Basic pKa: 9.99CX LogP: -1.40CX LogD: -1.63Aromatic Rings: ┄Heavy Atoms: 14QED Weighted: 0.51Np Likeness Score: 0.92
References 1. Nudelman A, Marcovici-Mizrahi D, Nudelman A, Flint D, Wittenbach V. (2004) Inhibitors of biotin biosynthesis as potential herbicides, 60 (8): [10.1016/j.tet.2003.12.047 ]