The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-carboxy-1-(methylthio)nonane-3,4-diaminium chloride ID: ALA2286781
PubChem CID: 76316424
Max Phase: Preclinical
Molecular Formula: C11H26Cl2N2O2S
Molecular Weight: 248.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSCCC(N)C(N)CCCCCC(=O)O.Cl.Cl
Standard InChI: InChI=1S/C11H24N2O2S.2ClH/c1-16-8-7-10(13)9(12)5-3-2-4-6-11(14)15;;/h9-10H,2-8,12-13H2,1H3,(H,14,15);2*1H
Standard InChI Key: KSGSXMSNVNIZGC-UHFFFAOYSA-N
Molfile:
RDKit 2D
18 15 0 0 0 0 0 0 0 0999 V2000
21.3616 -15.1152 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.8604 -17.7637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8454 -16.9388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5800 -16.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2751 -17.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0075 -16.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7027 -17.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4350 -16.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1301 -17.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8625 -16.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5576 -17.2065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8996 -15.9380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6172 -15.7447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1391 -16.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4168 -16.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7105 -16.4846 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.9881 -16.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2420 -18.2679 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
4 13 1 0
3 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 248.39Molecular Weight (Monoisotopic): 248.1558AlogP: 1.43#Rotatable Bonds: 10Polar Surface Area: 89.34Molecular Species: ZWITTERIONHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.50CX Basic pKa: 9.97CX LogP: -1.27CX LogD: -1.49Aromatic Rings: ┄Heavy Atoms: 16QED Weighted: 0.51Np Likeness Score: 0.40
References 1. Nudelman A, Marcovici-Mizrahi D, Nudelman A, Flint D, Wittenbach V. (2004) Inhibitors of biotin biosynthesis as potential herbicides, 60 (8): [10.1016/j.tet.2003.12.047 ]